loading...| Preferred Name |
cinoxacin |
|
| Synonyms |
1-ethyl-4-oxo-1,4-dihydro[1,3]dioxolo[4,5-g]cinnoline-3-carboxylic acid 5-Ethyl-8-oxo-5,8-dihydro-1,3-dioxa-5,6-diaza-cyclopenta[b]naphthalene-7-carboxylic acid cinoxacin cinoxacino 1-ethyl-6,7-methylenedioxy-4(1H)-oxocinnoline-3-carboxylic acid cinoxacinum cinoxacine |
|
| Definitions |
A member of the class of cinnolines that is 6,7-methylenedioxycinnolin-4(1H)-one bearing an ethyl group at position 1 and a carboxylic acid group at position 3. An analogue of oxolinic acid, it has similar antibacterial actions. It was formerly used for the treatment of urinary tract infections. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3716 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Cinoxacin CAS:28657-80-9 PMID:3147004 Patent:US3669965 PMID:6226270 LINCS:LSM-6552 Patent:US6441167 Patent:DE2005104 HMDB:HMDB0014965 VSDB:1881 Drug_Central:657 PMID:3005575 Beilstein:1084304 PMID:16295658 KEGG:D00872 PMID:12204384 DrugBank:DB00827 PMID:29438107 |
|
| definition |
A member of the class of cinnolines that is 6,7-methylenedioxycinnolin-4(1H)-one bearing an ethyl group at position 1 and a carboxylic acid group at position 3. An analogue of oxolinic acid, it has similar antibacterial actions. It was formerly used for the treatment of urinary tract infections. |
|
| formula |
C12H10N2O5 |
|
| has role | ||
| has_alternative_id |
CHEBI:314701 |
|
| has_exact_synonym |
1-ethyl-4-oxo-1,4-dihydro[1,3]dioxolo[4,5-g]cinnoline-3-carboxylic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
5-Ethyl-8-oxo-5,8-dihydro-1,3-dioxa-5,6-diaza-cyclopenta[b]naphthalene-7-carboxylic acid cinoxacin cinoxacino 1-ethyl-6,7-methylenedioxy-4(1H)-oxocinnoline-3-carboxylic acid cinoxacinum cinoxacine |
|
| id |
CHEBI:3716 |
|
| in_subset | ||
| inchi |
InChI=1S/C12H10N2O5/c1-2-14-7-4-9-8(18-5-19-9)3-6(7)11(15)10(13-14)12(16)17/h3-4H,2,5H2,1H3,(H,16,17) |
|
| inchikey |
VDUWPHTZYNWKRN-UHFFFAOYSA-N |
|
| label |
cinoxacin |
|
| mass |
262.21820 |
|
| monoisotopicmass |
262.05897 |
|
| notation |
CHEBI:3716 |
|
| prefLabel |
cinoxacin |
|
| smiles |
CCn1nc(C(O)=O)c(=O)c2cc3OCOc3cc12 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_25754 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_25754 |