Preferred Name |
permethrin |
|
Synonyms |
3-phenoxybenzyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate Permethrin permethrin 3-(2,2-Dichloroethenyl)-2,2-dimethylcyclopropane carboxylic acid, (3-phenoxyphenyl) methyl ester (3-Phenoxyphenyl)methyl (+-)-cis,trans-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
|
Definitions |
A cyclopropanecarboxylate ester in which the esterifying alcohol is 3-phenoxybenzyl alcohol and the cyclopropane ring is substituted with a 2,2-dichlorovinyl group and with gem-dimethyl groups. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_34911 |
|
charge |
0 |
|
database_cross_reference |
PMID:19343362 PMID:19835699 PMID:21812972 PMID:18692543 PMID:19278716 PMID:16423402 PMID:17220085 PMID:16599165 PMID:21133424 PMID:19090765 KEGG:D05443 PMID:17597311 PMID:21756140 PMID:21251955 DrugBank:DB04930 VSDB:515 PMID:21809414 PMID:12419701 PMID:11082455 PMID:16481707 PMID:17140720 PMID:21352824 PMID:14617103 PMID:21240732 PMID:15663293 Reaxys:5765325 PMID:18570364 PMID:21069313 Wikipedia:Permethrin Drug_Central:4152 PMID:18723882 PMID:21485369 PMID:17980950 PMID:19962303 CAS:52645-53-1 PMID:15599112 PMID:17451859 PMID:25042713 PPDB:515 PMID:21235202 PMID:15966049 PMID:19079720 PMID:20960224 PMID:18274958 KEGG:C14388 |
|
definition |
A cyclopropanecarboxylate ester in which the esterifying alcohol is 3-phenoxybenzyl alcohol and the cyclopropane ring is substituted with a 2,2-dichlorovinyl group and with gem-dimethyl groups. |
|
formula |
C21H20Cl2O3 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_39116 http://purl.obolibrary.org/obo/CHEBI_39259 http://purl.obolibrary.org/obo/CHEBI_73333 |
|
has_exact_synonym |
3-phenoxybenzyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate Permethrin |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
permethrin 3-(2,2-Dichloroethenyl)-2,2-dimethylcyclopropane carboxylic acid, (3-phenoxyphenyl) methyl ester (3-Phenoxyphenyl)methyl (+-)-cis,trans-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
|
id |
CHEBI:34911 |
|
in_subset | ||
inchi |
InChI=1S/C21H20Cl2O3/c1-21(2)17(12-18(22)23)19(21)20(24)25-13-14-7-6-10-16(11-14)26-15-8-4-3-5-9-15/h3-12,17,19H,13H2,1-2H3 |
|
inchikey |
RLLPVAHGXHCWKJ-UHFFFAOYSA-N |
|
label |
permethrin |
|
mass |
391.28710 |
|
monoisotopicmass |
390.07895 |
|
notation |
CHEBI:34911 |
|
prefLabel |
permethrin |
|
smiles |
CC1(C)C(C=C(Cl)Cl)C1C(=O)OCc1cccc(Oc2ccccc2)c1 |
|
treeView | ||
subClassOf |