Preferred Name |
potassium acetate |
|
Synonyms |
potassium acetate Potassium acetate AcOK MeCO2K CH3CO2K E261 KOAc Kaliumazetat |
|
Definitions |
A potassium salt comprising equal numbers of potassium and acetate ions |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_32029 |
|
charge |
0 |
|
database_cross_reference |
CAS:127-08-2 Wikipedia:Potassium_Acetate KEGG:C12554 KEGG:D01154 |
|
definition |
A potassium salt comprising equal numbers of potassium and acetate ions |
|
formula |
C2H3KO2 C2H3O2.K |
|
has part | ||
has role | ||
has_exact_synonym |
potassium acetate Potassium acetate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
AcOK MeCO2K CH3CO2K E261 KOAc Kaliumazetat |
|
id |
CHEBI:32029 |
|
in_subset | ||
inchi |
InChI=1S/C2H4O2.K/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 |
|
inchikey |
SCVFZCLFOSHCOH-UHFFFAOYSA-M |
|
label |
potassium acetate |
|
mass |
98.14230 |
|
monoisotopicmass |
97.97701 |
|
notation |
CHEBI:32029 |
|
prefLabel |
potassium acetate |
|
smiles |
[K+].CC([O-])=O |
|
treeView | ||
subClassOf |
Create mapping