Preferred Name |
aspartame |
|
Synonyms |
aspartamo AminoSweet E 951 3-Amino-N-(alpha-carboxyphenethyl)succinamic acid N-methyl ester NutraSweet L-Aspartyl-L-phenylalanine methyl ester Asp-phe-ome Sanecta aspartam 1-methyl N-L-alpha-aspartyl-L-phenylalanate aspartamum 3-Amino-N-(alpha-methoxycarbonylphenethyl) succinamic acid Aspartylphenylalanine methyl ester methyl L-alpha-aspartyl-L-phenylalaninate Aspartame |
|
Definitions |
A dipeptide obtained by formal condensation of the alpha-carboxy group of L-aspartic acid with the amino group of methyl L-phenylalaninate. Commonly used as an artificial sweetener. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_2877 |
|
charge |
0 |
|
database_cross_reference |
PMID:27298583 PDBeChem:PME PMID:25991916 PMID:27840415 DrugBank:DB00168 PMID:27614095 PMID:27492574 Reaxys:2223850 PMID:21372000 PMID:22354473 PMID:27088715 PMID:27699780 PMID:27015640 PMID:26582819 PMID:27565676 PMID:27127997 PMID:24944748 KEGG:C11045 PMID:25431414 CAS:22839-47-0 PMID:25951455 PMID:1771173 PMID:24965331 Beilstein:2223850 PMID:37297402 Patent:US3492131 PMID:21150094 Wikipedia:Aspartame PMID:26015492 PMID:2013754 PMID:26159964 PMID:27216413 PMID:26308194 PMID:27640132 PMID:26593524 PMID:26247507 PMID:26377607 PMID:30000570 PMID:27038223 PMID:26321723 PMID:25543075 PMID:24355796 PMID:37291632 PMID:26099025 PMID:25786106 PMID:37454665 PMID:27845306 PMID:26912665 KEGG:D02381 PMID:27728881 HMDB:HMDB0001894 PMID:24925367 |
|
definition |
A dipeptide obtained by formal condensation of the alpha-carboxy group of L-aspartic acid with the amino group of methyl L-phenylalaninate. Commonly used as an artificial sweetener. |
|
formula |
C14H18N2O5 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_68494 http://purl.obolibrary.org/obo/CHEBI_63332 http://purl.obolibrary.org/obo/CHEBI_27027 http://purl.obolibrary.org/obo/CHEBI_50505 |
|
has_alternative_id |
CHEBI:45047 |
|
has_exact_synonym |
methyl L-alpha-aspartyl-L-phenylalaninate Aspartame |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
aspartamo AminoSweet E 951 3-Amino-N-(alpha-carboxyphenethyl)succinamic acid N-methyl ester NutraSweet L-Aspartyl-L-phenylalanine methyl ester Asp-phe-ome Sanecta aspartam 1-methyl N-L-alpha-aspartyl-L-phenylalanate aspartamum 3-Amino-N-(alpha-methoxycarbonylphenethyl) succinamic acid Aspartylphenylalanine methyl ester |
|
id |
CHEBI:2877 |
|
in_subset | ||
inchi |
InChI=1S/C14H18N2O5/c1-21-14(20)11(7-9-5-3-2-4-6-9)16-13(19)10(15)8-12(17)18/h2-6,10-11H,7-8,15H2,1H3,(H,16,19)(H,17,18)/t10-,11-/m0/s1 |
|
inchikey |
IAOZJIPTCAWIRG-QWRGUYRKSA-N |
|
is tautomer of | ||
label |
aspartame |
|
mass |
294.304 |
|
monoisotopicmass |
294.12157 |
|
notation |
CHEBI:2877 |
|
prefLabel |
aspartame |
|
smiles |
C(C[C@@H](C(N[C@@H](CC1=CC=CC=C1)C(=O)OC)=O)N)(=O)O |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_46761 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_46761 |