loading...| Preferred Name |
amrinone |
|
| Synonyms |
5-amino[3,4'-bipyridin]-6(1H)-one amrinone |
|
| Definitions |
A 3,4'-bipyridine substituted at positions 5 and 6 by an amino group and a keto function respectively. A pyridine phosphodiesterase 3 inhibitor, it is a drug that may improve the prognosis in patients with congestive heart failure. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2686 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D00231 PMID:28166217 LINCS:LSM-6600 PMID:15064331 CAS:60719-84-8 PMID:16154150 PMID:23908328 PMID:15892406 Wikipedia:Amrinone KEGG:C06829 PMID:18468627 |
|
| definition |
A 3,4'-bipyridine substituted at positions 5 and 6 by an amino group and a keto function respectively. A pyridine phosphodiesterase 3 inhibitor, it is a drug that may improve the prognosis in patients with congestive heart failure. |
|
| formula |
C10H9N3O |
|
| has role | ||
| has_alternative_id |
CHEBI:95269 |
|
| has_exact_synonym |
5-amino[3,4'-bipyridin]-6(1H)-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
amrinone |
|
| id |
CHEBI:2686 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H9N3O/c11-9-5-8(6-13-10(9)14)7-1-3-12-4-2-7/h1-6H,11H2,(H,13,14) |
|
| inchikey |
RNLQIBCLLYYYFJ-UHFFFAOYSA-N |
|
| label |
amrinone |
|
| mass |
187.198 |
|
| monoisotopicmass |
187.07456 |
|
| notation |
CHEBI:2686 |
|
| prefLabel |
amrinone |
|
| smiles |
C1=CN=CC=C1C2=CNC(=O)C(=C2)N |
|
| treeView | ||
| subClassOf |