Preferred Name |
limonene |
|
Synonyms |
1-methyl-4-(prop-1-en-2-yl)cyclohex-1-ene Limonene p-mentha-1,8-diene limonene 4-isopropenyl-1-methylcyclohexene Cajeputene 1,8-p-menthadiene (+-)-(RS)-limonene dl-Limonene Kautschin (+/-)-limonene Dipentene 1-methyl-4-(1-methylethenyl)cyclohexene |
|
Definitions |
A monoterpene that is cyclohex-1-ene substituted by a methyl group at position 1 and a prop-1-en-2-yl group at position 4 respectively. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15384 |
|
charge |
0 |
|
database_cross_reference |
CAS:7705-14-8 KNApSAcK:C00003043 Reaxys:774123 UM-BBD_compID:c0626 KNApSAcK:C00000823 CAS:138-86-3 KEGG:C06078 |
|
definition |
A monoterpene that is cyclohex-1-ene substituted by a methyl group at position 1 and a prop-1-en-2-yl group at position 4 respectively. |
|
formula |
C10H16 |
|
has role | ||
has_alternative_id |
CHEBI:14506 CHEBI:6463 CHEBI:18466 |
|
has_exact_synonym |
1-methyl-4-(prop-1-en-2-yl)cyclohex-1-ene Limonene p-mentha-1,8-diene limonene |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
4-isopropenyl-1-methylcyclohexene Cajeputene 1,8-p-menthadiene (+-)-(RS)-limonene dl-Limonene Kautschin (+/-)-limonene Dipentene 1-methyl-4-(1-methylethenyl)cyclohexene |
|
id |
CHEBI:15384 |
|
in_subset | ||
inchi |
InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3 |
|
inchikey |
XMGQYMWWDOXHJM-UHFFFAOYSA-N |
|
label |
limonene |
|
mass |
136.23404 |
|
monoisotopicmass |
136.12520 |
|
notation |
CHEBI:15384 |
|
prefLabel |
limonene |
|
smiles |
CC(=C)C1CCC(C)=CC1 |
|
treeView | ||
subClassOf |