loading...| Preferred Name |
torasemide |
|
| Synonyms |
4-(3-methylanilino)-N-(propan-2-ylcarbamoyl)pyridine-3-sulfonamide N-(isopropylcarbamoyl)-4-[(3-methylphenyl)amino]pyridine-3-sulfonamide BM02015 Torem JDL 464 Luprac torasemida torasemidum BM-02.015 Demadex N-[(propan-2-yl)carbamoyl]-4-[(3-methylphenyl)amino]pyridine-3-sulfonamide JDL-464 BM02.015 BM 02015 torasemide 1-isopropyl-3-((4-m-toluidino-3-pyridyl)sulfonyl)urea N-(((1-methylethyl)amino)carbonyl)-4-((3-methylphenyl)amino)-3-pyridinesulfonamide AC-4464 BM-02015 AC 4464 Unat Torsemide AC4464 |
|
| Definitions |
An N-sulfonylurea obtained by formal condensation of [(3-methylphenyl)amino]pyridine-3-sulfonic acid with the free amino group of N-isopropylurea. It is a potent loop diuretic used for the treatment of hypertension and edema in patients with congestive heart failure. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9637 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:498515 PMID:24367917 PMID:22407343 PMID:32411731 PMID:21391491 PMID:32098657 PMID:22364690 PMID:24040049 PMID:32302808 PMID:23837587 HMDB:HMDB0014359 LINCS:LSM-2662 PMID:29488197 PMID:24432564 CAS:56211-40-6 PMID:28891228 PMID:22030290 PMID:30827731 PMID:24243991 Drug_Central:2708 PMID:31809955 PMID:23237447 PMID:23792294 DrugBank:DB00214 PMID:31124957 KEGG:D00382 PMID:31436024 PMID:21906812 PMID:23013124 PMID:24554915 PMID:31699358 PMID:23877845 Wikipedia:Torasemide PMID:30649675 |
|
| definition |
An N-sulfonylurea obtained by formal condensation of [(3-methylphenyl)amino]pyridine-3-sulfonic acid with the free amino group of N-isopropylurea. It is a potent loop diuretic used for the treatment of hypertension and edema in patients with congestive heart failure. |
|
| formula |
C16H20N4O3S |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
4-(3-methylanilino)-N-(propan-2-ylcarbamoyl)pyridine-3-sulfonamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
N-(isopropylcarbamoyl)-4-[(3-methylphenyl)amino]pyridine-3-sulfonamide BM02015 Torem JDL 464 Luprac torasemida torasemidum BM-02.015 Demadex N-[(propan-2-yl)carbamoyl]-4-[(3-methylphenyl)amino]pyridine-3-sulfonamide JDL-464 BM02.015 BM 02015 torasemide 1-isopropyl-3-((4-m-toluidino-3-pyridyl)sulfonyl)urea N-(((1-methylethyl)amino)carbonyl)-4-((3-methylphenyl)amino)-3-pyridinesulfonamide AC-4464 BM-02015 AC 4464 Unat Torsemide AC4464 |
|
| id |
CHEBI:9637 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H20N4O3S/c1-11(2)18-16(21)20-24(22,23)15-10-17-8-7-14(15)19-13-6-4-5-12(3)9-13/h4-11H,1-3H3,(H,17,19)(H2,18,20,21) |
|
| inchikey |
NGBFQHCMQULJNZ-UHFFFAOYSA-N |
|
| label |
torasemide |
|
| mass |
348.420 |
|
| monoisotopicmass |
348.12561 |
|
| notation |
CHEBI:9637 |
|
| prefLabel |
torasemide |
|
| smiles |
C=1(C(NC=2C=C(C=CC2)C)=CC=NC1)S(NC(NC(C)C)=O)(=O)=O |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_50995 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50995 |