loading...| Preferred Name |
sertraline hydrochloride |
|
| Synonyms |
Lustral (1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-aminium chloride (+)-cis-(1S,4S)-1-methylamino-4-(3,4-dichlorophenyl)tetralin hydrochloride (+)-sertraline hydrochloride Zoloft (1S-cis)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride sertraline HCl (1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride |
|
| Definitions |
A hydrochloride resulting from the reaction of equimolar amounts of sertraline and hydrogen chloride. A selective serotonin-reuptake inhibitor (SSRI), it is administered orally as an antidepressant for the treatment of depression, obsessive-compulsive disorder, panic disorder and post-traumatic stress disorder. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9124 |
|
| charge |
0 |
|
| database_cross_reference |
HMDB:HMDB0005010 PMID:8342482 PMID:19502000 PMID:17661734 PMID:21456103 PMID:19370626 PMID:21823671 Reaxys:5783715 PMID:12387695 CAS:79559-97-0 PMID:18980823 DrugBank:DB01104 PMID:20393946 PMID:19026250 PMID:12701343 Patent:US2008161412 PMID:21070110 KEGG:D00825 PMID:20953053 PMID:19584964 PMID:8675965 PMID:12772794 PMID:20457874 PMID:12452737 PMID:14596660 PMID:20383937 PMID:10184609 PMID:12093324 Wikipedia:Sertraline |
|
| definition |
A hydrochloride resulting from the reaction of equimolar amounts of sertraline and hydrogen chloride. A selective serotonin-reuptake inhibitor (SSRI), it is administered orally as an antidepressant for the treatment of depression, obsessive-compulsive disorder, panic disorder and post-traumatic stress disorder. |
|
| formula |
C17H18Cl3N |
|
| has part | ||
| has role | ||
| has_exact_synonym |
(1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Lustral (1S,4S)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-aminium chloride (+)-cis-(1S,4S)-1-methylamino-4-(3,4-dichlorophenyl)tetralin hydrochloride (+)-sertraline hydrochloride Zoloft (1S-cis)-4-(3,4-dichlorophenyl)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride sertraline HCl |
|
| id |
CHEBI:9124 |
|
| in_subset | ||
| inchi |
InChI=1S/C17H17Cl2N.ClH/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11;/h2-6,8,10,12,17,20H,7,9H2,1H3;1H/t12-,17-;/m0./s1 |
|
| inchikey |
BLFQGGGGFNSJKA-XHXSRVRCSA-N |
|
| label |
sertraline hydrochloride |
|
| mass |
342.69100 |
|
| monoisotopicmass |
341.05048 |
|
| notation |
CHEBI:9124 |
|
| prefLabel |
sertraline hydrochloride |
|
| smiles |
Cl.[H][C@]1(CC[C@H](NC)c2ccccc12)c1ccc(Cl)c(Cl)c1 |
|
| treeView | ||
| subClassOf |