loading...| Preferred Name |
sulfisoxazole diolamine |
|
| Synonyms |
4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzene-1-sulfonamide--2,2'-azanediyldi(ethan-1-ol) (1/1) Sulfafurazol 2,2'-imidodiethanol sulfisoxazole diethanolamine Sulfafurazole diolamine |
|
| Definitions |
An organoammonium salt obtained by combining equimolar amounts of sulfisoxazole and diethanolamine. It has antibiotic activity against a wide range of gram-negative and gram-positive organisms. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_88263 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D05957 PMID:7224931 CAS:4299-60-9 Reaxys:14856872 PMID:272602 PMID:14080864 PMID:13011090 PMID:641660 |
|
| definition |
An organoammonium salt obtained by combining equimolar amounts of sulfisoxazole and diethanolamine. It has antibiotic activity against a wide range of gram-negative and gram-positive organisms. |
|
| formula |
C15H24N4O5S |
|
| has part | ||
| has role | ||
| has_exact_synonym |
4-amino-N-(3,4-dimethyl-1,2-oxazol-5-yl)benzene-1-sulfonamide--2,2'-azanediyldi(ethan-1-ol) (1/1) |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Sulfafurazol 2,2'-imidodiethanol sulfisoxazole diethanolamine Sulfafurazole diolamine |
|
| id |
CHEBI:88263 |
|
| in_subset | ||
| inchi |
InChI=1S/C11H13N3O3S.C4H11NO2/c1-7-8(2)13-17-11(7)14-18(15,16)10-5-3-9(12)4-6-10;6-3-1-5-2-4-7/h3-6,14H,12H2,1-2H3;5-7H,1-4H2 |
|
| inchikey |
FEPTXVIRMZIGFY-UHFFFAOYSA-N |
|
| label |
sulfisoxazole diolamine |
|
| mass |
372.442 |
|
| monoisotopicmass |
372.14674 |
|
| notation |
CHEBI:88263 |
|
| prefLabel |
sulfisoxazole diolamine |
|
| smiles |
S(=O)(=O)(NC=1ON=C(C1C)C)C2=CC=C(N)C=C2.OCCNCCO |
|
| treeView | ||
| subClassOf |