loading...| Preferred Name |
propafenone hydrochloride |
|
| Synonyms |
1-{2-[2-hydroxy-3-(propylamino)propoxy]phenyl}-3-phenylpropan-1-one hydrochloride propafenone HCl 2-hydroxy-3-[2-(3-phenylpropanoyl)phenoxy]-N-propylpropan-1-aminium chloride Rythmol Arythmol Propafenon hydrochlorid |
|
| Definitions |
A hydrochloride that is the monohydrochloride salt of propafenone. It is a class 1C antiarrhythmic drug with local anesthetic effects, and is used in the management of supraventricular and ventricular arrhythmias. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8466 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D00640 DrugBank:DB01182 CAS:34183-22-7 Reaxys:4343069 |
|
| definition |
A hydrochloride that is the monohydrochloride salt of propafenone. It is a class 1C antiarrhythmic drug with local anesthetic effects, and is used in the management of supraventricular and ventricular arrhythmias. |
|
| formula |
C21H28ClNO3 C21H27NO3.HCl |
|
| has part | ||
| has role | ||
| has_exact_synonym |
1-{2-[2-hydroxy-3-(propylamino)propoxy]phenyl}-3-phenylpropan-1-one hydrochloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
propafenone HCl 2-hydroxy-3-[2-(3-phenylpropanoyl)phenoxy]-N-propylpropan-1-aminium chloride Rythmol Arythmol Propafenon hydrochlorid |
|
| id |
CHEBI:8466 |
|
| in_subset | ||
| inchi |
InChI=1S/C21H27NO3.ClH/c1-2-14-22-15-18(23)16-25-21-11-7-6-10-19(21)20(24)13-12-17-8-4-3-5-9-17;/h3-11,18,22-23H,2,12-16H2,1H3;1H |
|
| inchikey |
XWIHRGFIPXWGEF-UHFFFAOYSA-N |
|
| label |
propafenone hydrochloride |
|
| mass |
377.90500 |
|
| monoisotopicmass |
377.17577 |
|
| notation |
CHEBI:8466 |
|
| prefLabel |
propafenone hydrochloride |
|
| smiles |
Cl.CCCNCC(O)COc1ccccc1C(=O)CCc1ccccc1 |
|
| treeView | ||
| subClassOf |