Preferred Name |
dimethyldithiocarbamate |
|
Synonyms |
dimethyldithiocarbamate dimethyldithiocarbamic acid(1-) dimethyldithiocarbamic acid anion |
|
Definitions |
A member of the class of dithiocarbamate anions resulting from the removal of the proton from the dithiocarbamic acid moiety of dimethyldithiocarbamic acid. The major species at pH 7.3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_84293 |
|
charge |
-1 |
|
definition |
A member of the class of dithiocarbamate anions resulting from the removal of the proton from the dithiocarbamic acid moiety of dimethyldithiocarbamic acid. The major species at pH 7.3. |
|
formula |
C3H6NS2 |
|
has_exact_synonym |
dimethyldithiocarbamate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
dimethyldithiocarbamic acid(1-) dimethyldithiocarbamic acid anion |
|
id |
CHEBI:84293 |
|
in_subset | ||
inchi |
InChI=1S/C3H7NS2/c1-4(2)3(5)6/h1-2H3,(H,5,6)/p-1 |
|
inchikey |
MZGNSEAPZQGJRB-UHFFFAOYSA-M |
|
is conjugate base of | ||
label |
dimethyldithiocarbamate |
|
mass |
120.21700 |
|
monoisotopicmass |
119.99472 |
|
notation |
CHEBI:84293 |
|
prefLabel |
dimethyldithiocarbamate |
|
smiles |
CN(C)C([S-])=S |
|
treeView | ||
subClassOf |