loading...| Preferred Name |
N,N-dimethylacetamide |
|
| Synonyms |
dimethylacetamide N,N-dimethylacetamide |
|
| Definitions |
A member of the class of acetamides that is acetamide in which the hydrogens attached to the N atom have been replaced by two methyl groups respectively. Metabolite observed in cancer metabolism. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_84254 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Dimethylacetamide Reaxys:1737614 KEGG:C20339 CAS:127-19-5 PMID:25518943 |
|
| definition |
A member of the class of acetamides that is acetamide in which the hydrogens attached to the N atom have been replaced by two methyl groups respectively. Metabolite observed in cancer metabolism. |
|
| formula |
C4H9NO |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
N,N-dimethylacetamide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
dimethylacetamide |
|
| id |
CHEBI:84254 |
|
| in_subset | ||
| inchi |
InChI=1S/C4H9NO/c1-4(6)5(2)3/h1-3H3 |
|
| inchikey |
FXHOOIRPVKKKFG-UHFFFAOYSA-N |
|
| label |
N,N-dimethylacetamide |
|
| mass |
87.12040 |
|
| monoisotopicmass |
87.06841 |
|
| notation |
CHEBI:84254 |
|
| prefLabel |
N,N-dimethylacetamide |
|
| smiles |
CN(C)C(C)=O |
|
| treeView | ||
| subClassOf |