loading...| Preferred Name |
amantadine sulfate |
|
| Synonyms |
amantadine sulphate Amantadine sulphate adamantan-1-amine sulfate |
|
| Definitions |
An alkylammonium sulfate salt obtained by combining amantadine and sulfuric acid in a 2:1 ratio. Used as an antiviral and antiparkinson drug. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_78351 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:3374720 PMID:19056273 DrugBank:DB00915 PMID:12971972 Wikipedia:Amantadine PMID:19066095 PMID:11003631 PMID:8665560 PMID:2709063 PMID:18540467 PMID:21666589 CAS:31377-23-8 PMID:11454179 PMID:16710757 PMID:19894299 PMID:15057520 PMID:12774015 PMID:22550086 PMID:8821076 PMCID:PMC3967140 PMID:16492838 PMID:20639853 PMID:11981240 PMID:17089682 PMID:6523982 PMID:10907729 PMID:12618292 PMID:24045608 |
|
| definition |
An alkylammonium sulfate salt obtained by combining amantadine and sulfuric acid in a 2:1 ratio. Used as an antiviral and antiparkinson drug. |
|
| formula |
C20H36N2O4S |
|
| has part | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_48560 http://purl.obolibrary.org/obo/CHEBI_36044 http://purl.obolibrary.org/obo/CHEBI_60643 |
|
| has_exact_synonym |
adamantan-1-amine sulfate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
amantadine sulphate Amantadine sulphate |
|
| id |
CHEBI:78351 |
|
| in_subset | ||
| inchi |
InChI=1S/2C10H17N.H2O4S/c2*11-10-4-7-1-8(5-10)3-9(2-7)6-10;1-5(2,3)4/h2*7-9H,1-6,11H2;(H2,1,2,3,4) |
|
| inchikey |
MYWTWSQFJLXGGQ-UHFFFAOYSA-N |
|
| label |
amantadine sulfate |
|
| mass |
400.57600 |
|
| monoisotopicmass |
400.23958 |
|
| notation |
CHEBI:78351 |
|
| prefLabel |
amantadine sulfate |
|
| smiles |
OS(O)(=O)=O.NC12CC3CC(CC(C3)C1)C2.NC12CC3CC(CC(C3)C1)C2 |
|
| treeView | ||
| subClassOf |