loading...| Preferred Name |
terbinafine hydrochloride |
|
| Synonyms |
(2E)-N,6,6-trimethyl-N-(1-naphthylmethyl)hept-2-en-4-yn-1-aminium chloride (2E)-N,6,6-trimethyl-N-(1-naphthylmethyl)hept-2-en-4-yn-1-amine hydrochloride terbinafine monohydrochloride Lamisil (E)-N-(6,6-Dimethyl-2-hepten-4-ynyl)-N-methyl-1-naphthalenemethylamine hydrochloride Terbinafine HCl |
|
| Definitions |
A hydrochloride obtained by reaction of terbinafine with one molar equivalent of hydrogen chloride. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_77614 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:23263751 PMID:24490976 PMID:24410098 PMID:23553036 PMID:23333217 PMID:24373912 PMID:22923986 PMID:24447130 PMID:23525604 PMID:22297749 PMID:23615773 Reaxys:5660449 PMID:23740211 PMID:24270026 Wikipedia:Terbinafine PMID:24497012 CAS:78628-80-5 PMID:24249898 KEGG:D02219 PMID:24576265 PMID:23557842 PMID:23718650 PMID:22873754 PMID:23466900 PMID:23513554 PMID:23474809 PMID:23295582 PMID:23722995 PMID:23057672 DrugBank:DB00857 |
|
| definition |
A hydrochloride obtained by reaction of terbinafine with one molar equivalent of hydrogen chloride. |
|
| formula |
C21H26ClN |
|
| has part | ||
| has role | ||
| has_exact_synonym |
(2E)-N,6,6-trimethyl-N-(1-naphthylmethyl)hept-2-en-4-yn-1-aminium chloride (2E)-N,6,6-trimethyl-N-(1-naphthylmethyl)hept-2-en-4-yn-1-amine hydrochloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
terbinafine monohydrochloride Lamisil (E)-N-(6,6-Dimethyl-2-hepten-4-ynyl)-N-methyl-1-naphthalenemethylamine hydrochloride Terbinafine HCl |
|
| id |
CHEBI:77614 |
|
| in_subset | ||
| inchi |
InChI=1S/C21H25N.ClH/c1-21(2,3)15-8-5-9-16-22(4)17-19-13-10-12-18-11-6-7-14-20(18)19;/h5-7,9-14H,16-17H2,1-4H3;1H/b9-5+; |
|
| inchikey |
BWMISRWJRUSYEX-SZKNIZGXSA-N |
|
| label |
terbinafine hydrochloride |
|
| mass |
327.89100 |
|
| monoisotopicmass |
327.17538 |
|
| notation |
CHEBI:77614 |
|
| prefLabel |
terbinafine hydrochloride |
|
| smiles |
Cl.CN(C\C=C\C#CC(C)(C)C)Cc1cccc2ccccc12 |
|
| treeView | ||
| subClassOf |