loading...| Preferred Name |
monothioglycerol |
|
| Synonyms |
1-mercaptoglycerol alpha-thiolglycerol 1-thio-2,3-propanediol 1-mercapto-2,3-propanediol thioglycerin 1-thioglycerol 3-mercapto-1,2-propanediol monothioglycerin 3-mercaptopropane-1,2-diol 1-monothioglycerol 2,3-dihydroxypropanethiol thioglycerol thioglycerine monothioglycerol 3-sulfanylpropane-1,2-diol |
|
| Definitions |
A thiol that is glycerol in which one of the primary hydroxy groups is replaced by a thiol group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_74537 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:6166247 PMID:922117 Reaxys:1732046 CAS:96-27-5 Wikipedia:3-Mercaptopropane-1,2-diol PMID:6362560 MetaCyc:CPD0-1951 KEGG:D05075 PMID:6362561 PMID:18586770 |
|
| definition |
A thiol that is glycerol in which one of the primary hydroxy groups is replaced by a thiol group. |
|
| formula |
C3H8O2S |
|
| has role | ||
| has_exact_synonym |
monothioglycerol 3-sulfanylpropane-1,2-diol |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
1-mercaptoglycerol alpha-thiolglycerol 1-thio-2,3-propanediol 1-mercapto-2,3-propanediol thioglycerin 1-thioglycerol 3-mercapto-1,2-propanediol monothioglycerin 3-mercaptopropane-1,2-diol 1-monothioglycerol 2,3-dihydroxypropanethiol thioglycerol thioglycerine |
|
| id |
CHEBI:74537 |
|
| in_subset | ||
| inchi |
InChI=1S/C3H8O2S/c4-1-3(5)2-6/h3-6H,1-2H2 |
|
| inchikey |
PJUIMOJAAPLTRJ-UHFFFAOYSA-N |
|
| label |
monothioglycerol |
|
| mass |
108.15900 |
|
| monoisotopicmass |
108.02450 |
|
| notation |
CHEBI:74537 |
|
| prefLabel |
monothioglycerol |
|
| smiles |
OCC(O)CS |
|
| treeView | ||
| subClassOf |