loading...| Preferred Name |
dextromoramide |
|
| Synonyms |
(3S)-3-methyl-4-(morpholin-4-yl)-2,2-diphenyl-1-(pyrrolidin-1-yl)butan-1-one dextromoramida palfium SKF 5137 R 875 (+)-2,2-diphenyl-3-methyl-4-morpholinobutyrylpyrrolidine SKF-5137 dextromoramidum palphium (+)-3-methyl-4-morpholino-2,2-diphenyl-1-(pyrrolidin-1-yl)butanone dextromoramide pyrrolamidolum |
|
| Definitions |
An N-acylpyrrolidine arising by formal condensation of pyrrolidine with (3S)-3-methyl-4-(morpholin-4-yl)-2,2-diphenylbutanoic acid. An opioid analgesic that is structurally related to methadone, it is more poweful than morphine but shorter acting. It has been used (particularly as the hydrogen tartrate salt) for the treatment of severe pain, but was discontinued in the UK in 2004. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_74274 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:96553 PMID:13757828 CAS:357-56-2 PMID:8931067 Patent:GB822055 PMID:7632606 PMID:89885 KEGG:D07287 DrugBank:DB01529 PMID:9584342 Drug_Central:843 PMID:2295688 |
|
| definition |
An N-acylpyrrolidine arising by formal condensation of pyrrolidine with (3S)-3-methyl-4-(morpholin-4-yl)-2,2-diphenylbutanoic acid. An opioid analgesic that is structurally related to methadone, it is more poweful than morphine but shorter acting. It has been used (particularly as the hydrogen tartrate salt) for the treatment of severe pain, but was discontinued in the UK in 2004. |
|
| formula |
C25H32N2O2 |
|
| has role | ||
| has_exact_synonym |
(3S)-3-methyl-4-(morpholin-4-yl)-2,2-diphenyl-1-(pyrrolidin-1-yl)butan-1-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
dextromoramida palfium SKF 5137 R 875 (+)-2,2-diphenyl-3-methyl-4-morpholinobutyrylpyrrolidine SKF-5137 dextromoramidum palphium (+)-3-methyl-4-morpholino-2,2-diphenyl-1-(pyrrolidin-1-yl)butanone dextromoramide pyrrolamidolum |
|
| id |
CHEBI:74274 |
|
| in_subset | ||
| inchi |
InChI=1S/C25H32N2O2/c1-21(20-26-16-18-29-19-17-26)25(22-10-4-2-5-11-22,23-12-6-3-7-13-23)24(28)27-14-8-9-15-27/h2-7,10-13,21H,8-9,14-20H2,1H3/t21-/m1/s1 |
|
| inchikey |
INUNXTSAACVKJS-OAQYLSRUSA-N |
|
| label |
dextromoramide |
|
| mass |
392.53380 |
|
| monoisotopicmass |
392.24638 |
|
| notation |
CHEBI:74274 |
|
| prefLabel |
dextromoramide |
|
| smiles |
C[C@H](CN1CCOCC1)C(C(=O)N1CCCC1)(c1ccccc1)c1ccccc1 |
|
| treeView | ||
| subClassOf |