loading...| Preferred Name |
methyl anthranilate |
|
| Synonyms |
2-Aminobenzoic acid methyl ester o-Aminobenzoic acid methyl ester O-methyl anthranilate 2-Carbomethoxyaniline Anthranilic acid methyl ester Methyl o-aminobenzoate 2-(Methoxycarbonyl)aniline o-Carbomethoxyaniline |
|
| Definitions |
A benzoate ester that is the methyl ester of anthranilic acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_73244 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:20519632 PMID:22499556 BPDB:1626 Reaxys:606965 Wikipedia:Methyl_anthranilate HMDB:HMDB0029703 PMID:19645280 Patent:US2011104099 CAS:134-20-3 PMID:21882683 PMID:22457628 |
|
| definition |
A benzoate ester that is the methyl ester of anthranilic acid. |
|
| formula |
C8H9NO2 |
|
| has functional parent | ||
| has role | ||
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-Aminobenzoic acid methyl ester o-Aminobenzoic acid methyl ester O-methyl anthranilate 2-Carbomethoxyaniline Anthranilic acid methyl ester Methyl o-aminobenzoate 2-(Methoxycarbonyl)aniline o-Carbomethoxyaniline |
|
| id |
CHEBI:73244 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H9NO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,9H2,1H3 |
|
| inchikey |
VAMXMNNIEUEQDV-UHFFFAOYSA-N |
|
| label |
methyl anthranilate |
|
| mass |
151.16260 |
|
| monoisotopicmass |
151.06333 |
|
| notation |
CHEBI:73244 |
|
| prefLabel |
methyl anthranilate |
|
| smiles |
COC(=O)c1ccccc1N |
|
| treeView | ||
| subClassOf |