Preferred Name |
lomitapide |
|
Synonyms |
lomitapida lomitapide lomitapidum BMS 201038 AEGR 773 BMS201038 AEGR-773 Lojuxta BMS-201038 AEGR773 AEGR733 AEGR 733 Juxtapid AEGR-733 N-(2,2,2-trifluoroethyl)-9-{4-[4-({[4'-(trifluoromethyl)biphenyl-2-yl]carbonyl}amino)piperidin-1-yl]butyl}-9H-fluorene-9-carboxamide |
|
Definitions |
A member of the class of benzamides obtained by formal condensation of the carboxy group of 4'-(trifluoromethyl)biphenyl-2-carboxylic acid with the primary amino group of 9-[4-(4-aminopiperidin-1-yl)butyl]-N-(2,2,2-trifluoroethyl)-9H-fluorene-9-carboxamide. Used (as its mesylate salt) as a complement to a low-fat diet and other lipid-lowering treatments in patients with homozygous familial hypercholesterolemia. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_72297 |
|
charge |
0 |
|
database_cross_reference |
PMID:23147576 PMID:28154305 PMID:25702706 Patent:US2012035204 Patent:US2010273829 KEGG:D09637 PMID:20127562 Reaxys:13754976 PMID:28432645 PMID:28255870 PMID:27055957 PMID:21846156 PMID:27232459 PMID:22963620 PMID:28716835 Patent:US2008161279 Patent:US2003162788 PMID:26120010 DrugBank:DB08827 Wikipedia:Lomitapide PMID:28239069 CAS:182431-12-5 PMID:25257075 PMID:23122768 PMID:23122767 Patent:US2011288064 PMID:28598687 Patent:US2012071458 PMID:26686567 Drug_Central:4721 Patent:US2011288110 PMID:17215532 PMID:27785928 PMID:24366202 |
|
definition |
A member of the class of benzamides obtained by formal condensation of the carboxy group of 4'-(trifluoromethyl)biphenyl-2-carboxylic acid with the primary amino group of 9-[4-(4-aminopiperidin-1-yl)butyl]-N-(2,2,2-trifluoroethyl)-9H-fluorene-9-carboxamide. Used (as its mesylate salt) as a complement to a low-fat diet and other lipid-lowering treatments in patients with homozygous familial hypercholesterolemia. |
|
formula |
C39H37F6N3O2 |
|
has role | ||
has_exact_synonym |
N-(2,2,2-trifluoroethyl)-9-{4-[4-({[4'-(trifluoromethyl)biphenyl-2-yl]carbonyl}amino)piperidin-1-yl]butyl}-9H-fluorene-9-carboxamide |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
lomitapida lomitapide lomitapidum BMS 201038 AEGR 773 BMS201038 AEGR-773 Lojuxta BMS-201038 AEGR773 AEGR733 AEGR 733 Juxtapid AEGR-733 |
|
id |
CHEBI:72297 |
|
in_subset | ||
inchi |
InChI=1S/C39H37F6N3O2/c40-38(41,42)25-46-36(50)37(33-13-5-3-10-30(33)31-11-4-6-14-34(31)37)21-7-8-22-48-23-19-28(20-24-48)47-35(49)32-12-2-1-9-29(32)26-15-17-27(18-16-26)39(43,44)45/h1-6,9-18,28H,7-8,19-25H2,(H,46,50)(H,47,49) |
|
inchikey |
MBBCVAKAJPKAKM-UHFFFAOYSA-N |
|
is conjugate base of | ||
label |
lomitapide |
|
mass |
693.722 |
|
monoisotopicmass |
693.27900 |
|
notation |
CHEBI:72297 |
|
prefLabel |
lomitapide |
|
smiles |
C1(C(NCC(F)(F)F)=O)(CCCCN2CCC(CC2)NC(C3=C(C=CC=C3)C4=CC=C(C=C4)C(F)(F)F)=O)C=5C=CC=CC5C6=C1C=CC=C6 |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_22702 http://purl.obolibrary.org/obo/CHEBI_83565 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22702 http://purl.obolibrary.org/obo/CHEBI_83565 |