Preferred Name |
rivastigmine tartrate |
|
Synonyms |
3-[(1S)-1-(dimethylamino)ethyl]phenyl ethyl(methyl)carbamate (2R,3R)-2,3-dihydroxybutanedioate Exelon (1S)-1-(3-{[ethyl(methyl)carbamoyl]oxy}phenyl)-N,N-dimethylethanaminium (2R,3R)-3-carboxy-2,3-dihydroxypropanoate rivastigmine hydrogen tartrate SDZ-ENA 713 |
|
Definitions |
A tartrate salt obtained by reaction of rivastigmine with one equivalent of (R,R)-tartaric acid. A reversible cholinesterase inhibitor. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_64358 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:9305032 PMID:21880452 Patent:US2008306280 PMID:17122027 PMID:17612707 KEGG:D02558 DrugBank:DB00989 Patent:EP1980552 PMID:15119476 Patent:US2008255383 Patent:EP2233465 CAS:129101-54-8 |
|
definition |
A tartrate salt obtained by reaction of rivastigmine with one equivalent of (R,R)-tartaric acid. A reversible cholinesterase inhibitor. |
|
formula |
C18H28N2O8 |
|
has part | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_38323 |
|
has_exact_synonym |
3-[(1S)-1-(dimethylamino)ethyl]phenyl ethyl(methyl)carbamate (2R,3R)-2,3-dihydroxybutanedioate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Exelon (1S)-1-(3-{[ethyl(methyl)carbamoyl]oxy}phenyl)-N,N-dimethylethanaminium (2R,3R)-3-carboxy-2,3-dihydroxypropanoate rivastigmine hydrogen tartrate SDZ-ENA 713 |
|
id |
CHEBI:64358 |
|
in_subset | ||
inchi |
InChI=1S/C14H22N2O2.C4H6O6/c1-6-16(5)14(17)18-13-9-7-8-12(10-13)11(2)15(3)4;5-1(3(7)8)2(6)4(9)10/h7-11H,6H2,1-5H3;1-2,5-6H,(H,7,8)(H,9,10)/t11-;1-,2-/m01/s1 |
|
inchikey |
GWHQHAUAXRMMOT-MBANBULQSA-N |
|
label |
rivastigmine tartrate |
|
mass |
400.42350 |
|
monoisotopicmass |
400.18457 |
|
notation |
CHEBI:64358 |
|
prefLabel |
rivastigmine tartrate |
|
smiles |
O[C@H]([C@@H](O)C(O)=O)C(O)=O.CCN(C)C(=O)Oc1cccc(c1)[C@H](C)N(C)C |
|
treeView | ||
subClassOf |