Preferred Name |
crizotinib |
|
Synonyms |
3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(piperidin-4-yl)-1H-pyrazol-4-yl]pyridin-2-amine crizotinib PF-2341066 PF 2341066 (R)-crizotinib crizotinibum |
|
Definitions |
A 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(piperidin-4-yl)pyrazol-4-yl]pyridin-2-amine that has R configuration at the chiral centre. The active enantiomer, it acts as a kinase inhibitor and is used for the treatment of patients with locally advanced or metastatic non-small cell lung cancer (NSCLC) |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_64310 |
|
charge |
0 |
|
database_cross_reference |
CAS:877399-52-5 Wikipedia:Crizotinib LINCS:LSM-1027 PMID:21308771 PMID:22233293 PMID:22129595 PMID:22235099 PMID:22215748 PMID:22311682 PMID:24455567 PMID:22443113 PMID:22282074 PMID:24556908 PMID:24486291 PMID:22277784 KEGG:D09731 PMID:22397764 Reaxys:12133926 PMID:22323827 PMID:22316363 Drug_Central:4187 PMID:22321987 PMID:24427836 PMID:22129984 PMID:22385925 PMID:22435662 PMID:22191798 PMID:24491302 PMID:24444403 |
|
definition |
A 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(piperidin-4-yl)pyrazol-4-yl]pyridin-2-amine that has R configuration at the chiral centre. The active enantiomer, it acts as a kinase inhibitor and is used for the treatment of patients with locally advanced or metastatic non-small cell lung cancer (NSCLC) |
|
formula |
C21H22Cl2FN5O |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35610 |
|
has_alternative_id |
CHEBI:77554 |
|
has_exact_synonym |
3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(piperidin-4-yl)-1H-pyrazol-4-yl]pyridin-2-amine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
crizotinib PF-2341066 PF 2341066 (R)-crizotinib crizotinibum |
|
id |
CHEBI:64310 |
|
in_subset | ||
inchi |
InChI=1S/C21H22Cl2FN5O/c1-12(19-16(22)2-3-17(24)20(19)23)30-18-8-13(9-27-21(18)25)14-10-28-29(11-14)15-4-6-26-7-5-15/h2-3,8-12,15,26H,4-7H2,1H3,(H2,25,27)/t12-/m1/s1 |
|
inchikey |
KTEIFNKAUNYNJU-GFCCVEGCSA-N |
|
is enantiomer of | ||
label |
crizotinib |
|
mass |
450.33700 |
|
monoisotopicmass |
449.11854 |
|
notation |
CHEBI:64310 |
|
prefLabel |
crizotinib |
|
smiles |
C[C@@H](Oc1cc(cnc1N)-c1cnn(c1)C1CCNCC1)c1c(Cl)ccc(F)c1Cl |
|
treeView | ||
subClassOf |