loading...| Preferred Name |
cladribine |
|
| Synonyms |
2-chloro-2'-deoxy-beta-adenosine 2-chloro-6-amino-9-(2-deoxy-beta-D-erythro-pentofuranosyl)purine CldAdo 2-chlorodeoxyadenosine 2ClAdo cladribinum (2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol cladribina 2-chloro-deoxyadenosine cladribine 2-CdA 2-chloro-2'-deoxyadenosine Cladribine |
|
| Definitions |
2'-Deoxyadenosine in which the hydrogen at position 2 on the purine ring has been substituted by chlorine. It inhibits the synthesis and repair of DNA, particularly in lymphocytes and monocytes, and is used as an antimetabolite antineoplastic drug for the treatment of lymphoid malignancies including hairy-cell leukaemia and chronic lymphocytic leukaemia. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_567361 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB00242 Beilstein:624220 LINCS:LSM-5976 CAS:4291-63-8 Patent:EP173059 PMID:26024233 Drug_Central:667 KEGG:D01370 PMID:18570408 PMID:17526755 Wikipedia:Cladribine Patent:US4760137 |
|
| definition |
2'-Deoxyadenosine in which the hydrogen at position 2 on the purine ring has been substituted by chlorine. It inhibits the synthesis and repair of DNA, particularly in lymphocytes and monocytes, and is used as an antimetabolite antineoplastic drug for the treatment of lymphoid malignancies including hairy-cell leukaemia and chronic lymphocytic leukaemia. |
|
| formula |
C10H12ClN5O3 |
|
| has role | ||
| has_alternative_id |
CHEBI:31407 CHEBI:568373 |
|
| has_exact_synonym |
2-chloro-2'-deoxyadenosine Cladribine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
2-chloro-2'-deoxy-beta-adenosine 2-chloro-6-amino-9-(2-deoxy-beta-D-erythro-pentofuranosyl)purine CldAdo 2-chlorodeoxyadenosine 2ClAdo cladribinum (2R,3S,5R)-5-(6-amino-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol cladribina 2-chloro-deoxyadenosine cladribine 2-CdA |
|
| id |
CHEBI:567361 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H12ClN5O3/c11-10-14-8(12)7-9(15-10)16(3-13-7)6-1-4(18)5(2-17)19-6/h3-6,17-18H,1-2H2,(H2,12,14,15)/t4-,5+,6+/m0/s1 |
|
| inchikey |
PTOAARAWEBMLNO-KVQBGUIXSA-N |
|
| label |
cladribine |
|
| mass |
285.68700 |
|
| monoisotopicmass |
285.06287 |
|
| notation |
CHEBI:567361 |
|
| prefLabel |
cladribine |
|
| smiles |
Nc1nc(Cl)nc2n(cnc12)[C@H]1C[C@H](O)[C@@H](CO)O1 |
|
| treeView | ||
| subClassOf |