loading...| Preferred Name |
methylisothiazolinone |
|
| Synonyms |
2-methyl-1,2-thiazol-3(2H)-one MIT MI 2-Methyl-4-isothiazolin-3-one 2-Methyl-3(2H)-isothiazolone |
|
| Definitions |
A 1,2-thazole that is 4-isothiazolin-3-one bearing a methyl group on the nitrogen atom. It is a powerful biocide and preservative and is the minor active ingredient in the commercial product Kathon(TM). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_53620 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:23340392 PMID:23510348 Beilstein:606203 PMID:21504436 PMID:18198720 PMID:21616561 Wikipedia:Methylisothiazolinone PMID:23510349 PMID:23601061 CAS:2682-20-4 Reaxys:606203 PMID:21777214 Patent:EP2289335 |
|
| definition |
A 1,2-thazole that is 4-isothiazolin-3-one bearing a methyl group on the nitrogen atom. It is a powerful biocide and preservative and is the minor active ingredient in the commercial product Kathon(TM). |
|
| formula |
C4H5NOS |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_51076 |
|
| has_exact_synonym |
2-methyl-1,2-thiazol-3(2H)-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
MIT MI 2-Methyl-4-isothiazolin-3-one 2-Methyl-3(2H)-isothiazolone |
|
| id |
CHEBI:53620 |
|
| in_subset | ||
| inchi |
InChI=1S/C4H5NOS/c1-5-4(6)2-3-7-5/h2-3H,1H3 |
|
| inchikey |
BEGLCMHJXHIJLR-UHFFFAOYSA-N |
|
| label |
methylisothiazolinone |
|
| mass |
115.15400 |
|
| monoisotopicmass |
115.00918 |
|
| notation |
CHEBI:53620 |
|
| prefLabel |
methylisothiazolinone |
|
| smiles |
Cn1sccc1=O |
|
| treeView | ||
| subClassOf |