loading...| Preferred Name |
flurazepam |
|
| Synonyms |
7-chloro-1-[2-(diethylamino)ethyl]-5-(2-fluorophenyl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one Ro 5-6901 flurazepam flurazepamum Insumin |
|
| Definitions |
A 1,4-benzodiazepinone that is 1,3-dihydro-2H-1,4-benzodiazepin-2-one substituted by a 2-(diethylamino)ethyl group, 2-fluorophenyl group and chloro group at positions 1, 5 and 7, respectively. It is a partial agonist of GABAA receptors and used for the treatment of insomnia. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5128 |
|
| charge |
0 |
|
| database_cross_reference |
PDBeChem:FL7 KEGG:D00329 PMID:2863335 Wikipedia:Flurazepam DrugBank:DB00690 Drug_Central:1218 PMID:20002022 HMDB:HMDB0014828 PMID:16501350 PMID:23035248 CAS:17617-23-1 |
|
| definition |
A 1,4-benzodiazepinone that is 1,3-dihydro-2H-1,4-benzodiazepin-2-one substituted by a 2-(diethylamino)ethyl group, 2-fluorophenyl group and chloro group at positions 1, 5 and 7, respectively. It is a partial agonist of GABAA receptors and used for the treatment of insomnia. |
|
| formula |
C21H23ClFN3O |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_35474 http://purl.obolibrary.org/obo/CHEBI_35717 |
|
| has_exact_synonym |
7-chloro-1-[2-(diethylamino)ethyl]-5-(2-fluorophenyl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Ro 5-6901 flurazepam flurazepamum Insumin |
|
| id |
CHEBI:5128 |
|
| in_subset | ||
| inchi |
InChI=1S/C21H23ClFN3O/c1-3-25(4-2)11-12-26-19-10-9-15(22)13-17(19)21(24-14-20(26)27)16-7-5-6-8-18(16)23/h5-10,13H,3-4,11-12,14H2,1-2H3 |
|
| inchikey |
SAADBVWGJQAEFS-UHFFFAOYSA-N |
|
| label |
flurazepam |
|
| mass |
387.880 |
|
| monoisotopicmass |
387.15137 |
|
| notation |
CHEBI:5128 |
|
| prefLabel |
flurazepam |
|
| smiles |
C(CN(CC)CC)N1C=2C(C(=NCC1=O)C3=CC=CC=C3F)=CC(=CC2)Cl |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_36683 http://purl.obolibrary.org/obo/CHEBI_35500 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_36683 http://purl.obolibrary.org/obo/CHEBI_35500 |