loading...| Preferred Name |
mianserin |
|
| Synonyms |
2-methyl-1,2,3,4,10,14b-hexahydrodibenzo[c,f]pyrazino[1,2-a]azepine mianserin mianserine mianserinum 1,2,3,4,10,14b-Hexahydro-2-methyldibenzo(c,f)pyrazino(1,2-a)azepine mianserina |
|
| Definitions |
A dibenzoazepine (specifically 1,2,3,4,10,14b-hexahydrodibenzo[c,f]pyrazino[1,2-a]azepine) methyl-substituted on N-2. Closely related to (and now mostly superseded by) the tetracyclic antidepressant mirtazapinean, it is an atypical antidepressant used in the treatment of depression throughout Europe and elsewhere. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_51137 |
|
| charge |
0 |
|
| database_cross_reference |
Patent:NL6603256 Drug_Central:1796 Beilstein:755346 PMID:20825390 Wikipedia:Mianserin LINCS:LSM-1374 PMID:18033297 Patent:US3534041 CAS:24219-97-4 DrugBank:DB06148 |
|
| definition |
A dibenzoazepine (specifically 1,2,3,4,10,14b-hexahydrodibenzo[c,f]pyrazino[1,2-a]azepine) methyl-substituted on N-2. Closely related to (and now mostly superseded by) the tetracyclic antidepressant mirtazapinean, it is an atypical antidepressant used in the treatment of depression throughout Europe and elsewhere. |
|
| formula |
C18H20N2 |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_37955 http://purl.obolibrary.org/obo/CHEBI_35678 http://purl.obolibrary.org/obo/CHEBI_176497 http://purl.obolibrary.org/obo/CHEBI_76779 http://purl.obolibrary.org/obo/CHEBI_48279 http://purl.obolibrary.org/obo/CHEBI_35717 http://purl.obolibrary.org/obo/CHEBI_37890 |
|
| has_exact_synonym |
2-methyl-1,2,3,4,10,14b-hexahydrodibenzo[c,f]pyrazino[1,2-a]azepine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
mianserin mianserine mianserinum 1,2,3,4,10,14b-Hexahydro-2-methyldibenzo(c,f)pyrazino(1,2-a)azepine mianserina |
|
| id |
CHEBI:51137 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H20N2/c1-19-10-11-20-17-9-5-3-7-15(17)12-14-6-2-4-8-16(14)18(20)13-19/h2-9,18H,10-13H2,1H3 |
|
| inchikey |
UEQUQVLFIPOEMF-UHFFFAOYSA-N |
|
| label |
mianserin |
|
| mass |
264.36480 |
|
| monoisotopicmass |
264.16265 |
|
| notation |
CHEBI:51137 |
|
| prefLabel |
mianserin |
|
| smiles |
CN1CCN2C(C1)c1ccccc1Cc1ccccc21 |
|
| treeView | ||
| subClassOf |