loading...| Preferred Name |
arsenous acid |
|
| Synonyms |
arsenous acid trihydrogen trioxoarsenate(3-) trioxoarsenic acid trihydroxidoarsenic As(OH)3 [As(OH)3] arsorous acid H3AsO3 TRIHYDROXYARSENITE(III) Arsenic trioxide |
|
| Definitions |
An arsenic oxoacid consisting of three hydroxy groups attached to a central arsenic atom. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_49900 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:C06697 CAS:1327-53-3 UM-BBD_compID:c0532 KEGG:C13619 DrugBank:DB04456 CAS:13464-58-9 Gmelin:1397624 KEGG:D02106 PDBeChem:TAS |
|
| definition |
An arsenic oxoacid consisting of three hydroxy groups attached to a central arsenic atom. |
|
| formula |
AsH3O3 |
|
| has_alternative_id |
CHEBI:22635 CHEBI:49899 |
|
| has_exact_synonym |
arsenous acid trihydrogen trioxoarsenate(3-) trioxoarsenic acid trihydroxidoarsenic |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
As(OH)3 [As(OH)3] arsorous acid H3AsO3 TRIHYDROXYARSENITE(III) Arsenic trioxide |
|
| id |
CHEBI:49900 |
|
| in_subset | ||
| inchi |
InChI=1S/AsH3O3/c2-1(3)4/h2-4H |
|
| inchikey |
GCPXMJHSNVMWNM-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
arsenous acid |
|
| mass |
125.94362 |
|
| monoisotopicmass |
125.92981 |
|
| notation |
CHEBI:49900 |
|
| prefLabel |
arsenous acid |
|
| smiles |
O[As](O)O |
|
| treeView | ||
| subClassOf |