Preferred Name |
butane-1,2,3,4-tetrol |
|
Synonyms |
butane-1,2,3,4-tetrol Phycitol Phycite 1,2,3,4-tetrahydroxybutane Erythrol Erythrite |
|
Definitions |
A tetritol that is butane substituted by hydroxy groups at positions 1, 2, 3 and 4. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_48299 |
|
charge |
0 |
|
database_cross_reference |
KNApSAcK:C00001161 CAS:7541-59-5 KEGG:C00503 CAS:149-32-6 KEGG:D08915 Beilstein:1735878 Reaxys:1735878 |
|
definition |
A tetritol that is butane substituted by hydroxy groups at positions 1, 2, 3 and 4. |
|
formula |
C4H10O4 |
|
has_exact_synonym |
butane-1,2,3,4-tetrol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Phycitol Phycite 1,2,3,4-tetrahydroxybutane Erythrol Erythrite |
|
id |
CHEBI:48299 |
|
in_subset | ||
inchi |
InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2 |
|
inchikey |
UNXHWFMMPAWVPI-UHFFFAOYSA-N |
|
label |
butane-1,2,3,4-tetrol |
|
mass |
122.11980 |
|
monoisotopicmass |
122.05791 |
|
notation |
CHEBI:48299 |
|
prefLabel |
butane-1,2,3,4-tetrol |
|
smiles |
OCC(O)C(O)CO |
|
treeView | ||
subClassOf |
Create mapping