Preferred Name |
2-aminopurine |
|
Synonyms |
1H-purin-2-amine 2'-amino-purine 2-amino purine 9H-purin-2-amine |
|
Definitions |
The parent compound of the 2-aminopurines, comprising a purine core carrying an amino substituent at the 2-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_479072 |
|
charge |
0 |
|
database_cross_reference |
PMID:11540922 Reaxys:5053 PMID:18463320 LINCS:LSM-5484 PMID:17070518 PMID:11120885 CAS:452-06-2 |
|
definition |
The parent compound of the 2-aminopurines, comprising a purine core carrying an amino substituent at the 2-position. |
|
formula |
C5H5N5 |
|
has role | ||
has_exact_synonym |
9H-purin-2-amine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1H-purin-2-amine 2'-amino-purine 2-amino purine |
|
id |
CHEBI:479072 |
|
in_subset | ||
inchi |
InChI=1S/C5H5N5/c6-5-7-1-3-4(10-5)9-2-8-3/h1-2H,(H3,6,7,8,9,10) |
|
inchikey |
MWBWWFOAEOYUST-UHFFFAOYSA-N |
|
label |
2-aminopurine |
|
mass |
135.12670 |
|
monoisotopicmass |
135.05450 |
|
notation |
CHEBI:479072 |
|
prefLabel |
2-aminopurine |
|
smiles |
Nc1ncc2nc[nH]c2n1 |
|
treeView | ||
subClassOf |
Create mapping