loading...| Preferred Name |
edrophonium chloride |
|
| Synonyms |
EDROPHONIUM CHLORIDE N-ethyl-3-hydroxy-N,N-dimethylanilinium chloride ethyl(m-hydroxyphenyl)dimethylammonium chloride cloruro de edrofonio (3-hydroxyphenyl)dimethylethylammonium chloride chlorure d'edrophonium N-ethyl-3-hydroxy-N,N-dimethylbenzenaminium chloride edrophonii chloridum edrophonium chloride 3-hydroxy-N,N-dimethyl-N-ethylanilinium chloride |
|
| Definitions |
The chloride salt of edrophonium. A reversible inhibitor of cholinesterase with a rapid onset (30-60 seconds after injection) but a short duration of action (5-15 minutes), it is used in myasthenia gravis both diagnostically and to distinguish between under- or over-treatment with other anticholinesterases. It has also been used for the reversal of neuromuscular blockade in anaesthesia, and for the management of poisoning due to tetrodotoxin, a neuromuscular blocking toxin found in puffer fish and other marine animals. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4759 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Edrophonium Beilstein:3748734 CAS:116-38-1 KEGG:D00994 PMID:7488499 DrugBank:DB01010 Patent:US2647924 |
|
| definition |
The chloride salt of edrophonium. A reversible inhibitor of cholinesterase with a rapid onset (30-60 seconds after injection) but a short duration of action (5-15 minutes), it is used in myasthenia gravis both diagnostically and to distinguish between under- or over-treatment with other anticholinesterases. It has also been used for the reversal of neuromuscular blockade in anaesthesia, and for the management of poisoning due to tetrodotoxin, a neuromuscular blocking toxin found in puffer fish and other marine animals. |
|
| formula |
C10H16ClNO |
|
| has part | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_50247 |
|
| has_alternative_id |
CHEBI:267875 |
|
| has_exact_synonym |
EDROPHONIUM CHLORIDE N-ethyl-3-hydroxy-N,N-dimethylanilinium chloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
ethyl(m-hydroxyphenyl)dimethylammonium chloride cloruro de edrofonio (3-hydroxyphenyl)dimethylethylammonium chloride chlorure d'edrophonium N-ethyl-3-hydroxy-N,N-dimethylbenzenaminium chloride edrophonii chloridum edrophonium chloride 3-hydroxy-N,N-dimethyl-N-ethylanilinium chloride |
|
| id |
CHEBI:4759 |
|
| in_subset | ||
| inchi |
InChI=1S/C10H15NO.ClH/c1-4-11(2,3)9-6-5-7-10(12)8-9;/h5-8H,4H2,1-3H3;1H |
|
| inchikey |
BXKDSDJJOVIHMX-UHFFFAOYSA-N |
|
| label |
edrophonium chloride |
|
| mass |
201.69300 |
|
| monoisotopicmass |
201.09204 |
|
| notation |
CHEBI:4759 |
|
| prefLabel |
edrophonium chloride |
|
| smiles |
[Cl-].CC[N+](C)(C)c1cccc(O)c1 |
|
| treeView | ||
| subClassOf |