loading...| Preferred Name |
3,6-diamino-10-methylacridinium chloride |
|
| Synonyms |
3,6-diamino-10-methylacridinium chloride trypaflavine acriflavine C.I. 46000 |
|
| Definitions |
The 10-methochloride salt of 3,6-diaminoacridine. Note that a mixture of this compound with 3,6-diaminoacridine (proflavine) is known as acriflavine or neutral acriflavine. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_383703 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:3579028 CAS:86-40-8 PMID:6737429 |
|
| definition |
The 10-methochloride salt of 3,6-diaminoacridine. Note that a mixture of this compound with 3,6-diaminoacridine (proflavine) is known as acriflavine or neutral acriflavine. |
|
| formula |
C14H14ClN3 |
|
| has part | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_24853 http://purl.obolibrary.org/obo/CHEBI_33282 http://purl.obolibrary.org/obo/CHEBI_50903 |
|
| has_exact_synonym |
3,6-diamino-10-methylacridinium chloride |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
trypaflavine acriflavine C.I. 46000 |
|
| id |
CHEBI:383703 |
|
| in_subset | ||
| inchi |
InChI=1S/C14H13N3.ClH/c1-17-13-7-11(15)4-2-9(13)6-10-3-5-12(16)8-14(10)17;/h2-8H,1H3,(H3,15,16);1H |
|
| inchikey |
KKAJSJJFBSOMGS-UHFFFAOYSA-N |
|
| label |
3,6-diamino-10-methylacridinium chloride |
|
| mass |
259.73400 |
|
| monoisotopicmass |
259.08763 |
|
| notation |
CHEBI:383703 |
|
| prefLabel |
3,6-diamino-10-methylacridinium chloride |
|
| smiles |
[Cl-].C[n+]1c2cc(N)ccc2cc2ccc(N)cc12 |
|
| treeView | ||
| subClassOf |