Preferred Name |
2-amino-3-hydroxybutanoic acid |
|
Synonyms |
2-amino-3-hydroxybutanoic acid |
|
Definitions |
An alpha-amino acid that is butanoic acid substituted by an amino group at position 2 and a hydroxy group at position 3. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_38263 |
|
charge |
0 |
|
database_cross_reference |
Beilstein:1098902 |
|
definition |
An alpha-amino acid that is butanoic acid substituted by an amino group at position 2 and a hydroxy group at position 3. |
|
formula |
C4H9NO3 |
|
has role | ||
has_exact_synonym |
2-amino-3-hydroxybutanoic acid |
|
has_obo_namespace |
chebi_ontology |
|
id |
CHEBI:38263 |
|
in_subset | ||
inchi |
InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8) |
|
inchikey |
AYFVYJQAPQTCCC-UHFFFAOYSA-N |
|
label |
2-amino-3-hydroxybutanoic acid |
|
mass |
119.11920 |
|
monoisotopicmass |
119.05824 |
|
notation |
CHEBI:38263 |
|
prefLabel |
2-amino-3-hydroxybutanoic acid |
|
smiles |
CC(O)C(N)C(O)=O |
|
treeView | ||
subClassOf |
Create mapping