Preferred Name |
clemastine fumarate |
|
Synonyms |
(2R)-2-{2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl}-1-methylpyrrolidine (2E)-but-2-enedioate (2R)-2-{2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl}-1-methylpyrrolidinium (2E)-3-carboxyprop-2-enoate (+)-(2R)-2-(2-(((R)-p-chloro-alpha-methyl-alpha-phenylbenzyl)oxy)ethyl)-1-methylpyrrolidine fumarate (1:1) clemastine hydrogen fumarate |
|
Definitions |
The fumaric acid salt of clemastine. An antihistamine with antimuscarinic and moderate sedative properties, it is used for the symptomatic relief of allergic conditions such as rhinitis, urticaria, conjunctivitis and in pruritic (severe itching) skin conditions. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3739 |
|
charge |
0 |
|
database_cross_reference |
Beilstein:6472482 DrugBank:DB00283 KEGG:D00666 CAS:14976-57-9 |
|
definition |
The fumaric acid salt of clemastine. An antihistamine with antimuscarinic and moderate sedative properties, it is used for the symptomatic relief of allergic conditions such as rhinitis, urticaria, conjunctivitis and in pruritic (severe itching) skin conditions. |
|
formula |
C25H30ClNO5 |
|
has part | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_37955 http://purl.obolibrary.org/obo/CHEBI_48876 |
|
has_exact_synonym |
(2R)-2-{2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl}-1-methylpyrrolidine (2E)-but-2-enedioate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(2R)-2-{2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl}-1-methylpyrrolidinium (2E)-3-carboxyprop-2-enoate (+)-(2R)-2-(2-(((R)-p-chloro-alpha-methyl-alpha-phenylbenzyl)oxy)ethyl)-1-methylpyrrolidine fumarate (1:1) clemastine hydrogen fumarate |
|
id |
CHEBI:3739 |
|
in_subset | ||
inchi |
InChI=1S/C21H26ClNO.C4H4O4/c1-21(17-7-4-3-5-8-17,18-10-12-19(22)13-11-18)24-16-14-20-9-6-15-23(20)2;5-3(6)1-2-4(7)8/h3-5,7-8,10-13,20H,6,9,14-16H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t20-,21-;/m1./s1 |
|
inchikey |
PMGQWSIVQFOFOQ-YKVZVUFRSA-N |
|
label |
clemastine fumarate |
|
mass |
459.96200 |
|
monoisotopicmass |
459.18125 |
|
notation |
CHEBI:3739 |
|
prefLabel |
clemastine fumarate |
|
smiles |
OC(=O)\C=C\C(O)=O.[H][C@@]1(CCCN1C)CCO[C@](C)(c1ccccc1)c1ccc(Cl)cc1 |
|
treeView | ||
subClassOf |