loading...| Preferred Name |
4-coumaric acid |
|
| Synonyms |
3-(4-hydroxyphenyl)prop-2-enoic acid 4-coumaric acid beta-[4-hydroxyphenyl]acrylic acid 4'-hydroxycinnamic acid p-hydroxyphenylacrylic acid para-coumaric acid 3-(4-hydroxyphenyl)acrylic acid 3-(4-hydroxyphenyl)-2-propenoic acid p-coumaric acid p-hydroxycinnamic acid 4-hydroxycinnamic acid |
|
| Definitions |
A coumaric acid in which the hydroxy substituent is located at C-4 of the phenyl ring. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_36090 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:23892112 PMID:19930809 PMID:22585412 PMID:23857900 PMID:23485470 PMID:22447332 PMID:19089825 PMID:24927550 PMID:22923003 Wikipedia:4-coumaric_acid PMID:23669407 CAS:7400-08-0 Beilstein:2207381 PMID:23684599 PMID:23420453 PMID:7285584 PMID:23810795 PMID:11684179 PMID:23178520 |
|
| definition |
A coumaric acid in which the hydroxy substituent is located at C-4 of the phenyl ring. |
|
| formula |
C9H8O3 |
|
| has role | ||
| has_alternative_id |
CHEBI:20405 CHEBI:20348 |
|
| has_exact_synonym |
3-(4-hydroxyphenyl)prop-2-enoic acid 4-coumaric acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
beta-[4-hydroxyphenyl]acrylic acid 4'-hydroxycinnamic acid p-hydroxyphenylacrylic acid para-coumaric acid 3-(4-hydroxyphenyl)acrylic acid 3-(4-hydroxyphenyl)-2-propenoic acid p-coumaric acid p-hydroxycinnamic acid 4-hydroxycinnamic acid |
|
| id |
CHEBI:36090 |
|
| in_subset | ||
| inchi |
InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12) |
|
| inchikey |
NGSWKAQJJWESNS-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
4-coumaric acid |
|
| mass |
164.15802 |
|
| monoisotopicmass |
164.04734 |
|
| notation |
CHEBI:36090 |
|
| prefLabel |
4-coumaric acid |
|
| smiles |
[H]C(=Cc1ccc(O)cc1)C(O)=O |
|
| treeView | ||
| subClassOf |