loading...| Preferred Name |
cephalexin monohydrate |
|
| Synonyms |
7beta-[(2R)-2-amino-2-phenylacetamido]-3-methyl-3,4-didehydrocepham-4-carboxylic acid--water (1/1) (6R,7R)-7-{[(2R)-2-amino-2-phenylacetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid--water (1/1) Cephalexin monohydrate cephalexin hydrate Cephalexin cephalexin.H2O 7-(D-alpha-amino-alpha-phenylacetamido)-3-methyl-3-cephem-4-carboxylic acid monohydrate cefalexin monohydrate cefalexin.H2O cefalexin hydrate |
|
| Definitions |
A hydrate of cephalexin consisting of equimolar amounts of hydrate and cephalexin. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3535 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB00567 KEGG:C08099 CAS:23325-78-2 KEGG:D00906 Beilstein:8175806 |
|
| definition |
A hydrate of cephalexin consisting of equimolar amounts of hydrate and cephalexin. |
|
| formula |
C16H17N3O4S.H2O |
|
| has part | ||
| has role | ||
| has_exact_synonym |
7beta-[(2R)-2-amino-2-phenylacetamido]-3-methyl-3,4-didehydrocepham-4-carboxylic acid--water (1/1) (6R,7R)-7-{[(2R)-2-amino-2-phenylacetyl]amino}-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid--water (1/1) Cephalexin monohydrate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
cephalexin hydrate Cephalexin cephalexin.H2O 7-(D-alpha-amino-alpha-phenylacetamido)-3-methyl-3-cephem-4-carboxylic acid monohydrate cefalexin monohydrate cefalexin.H2O cefalexin hydrate |
|
| id |
CHEBI:3535 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H17N3O4S.H2O/c1-8-7-24-15-11(14(21)19(15)12(8)16(22)23)18-13(20)10(17)9-5-3-2-4-6-9;/h2-6,10-11,15H,7,17H2,1H3,(H,18,20)(H,22,23);1H2/t10-,11-,15-;/m1./s1 |
|
| inchikey |
AVGYWQBCYZHHPN-CYJZLJNKSA-N |
|
| label |
cephalexin monohydrate |
|
| mass |
365.40400 |
|
| monoisotopicmass |
365.10454 |
|
| notation |
CHEBI:3535 |
|
| prefLabel |
cephalexin monohydrate |
|
| smiles |
O.[H][C@]12SCC(C)=C(N1C(=O)[C@H]2NC(=O)[C@H](N)c1ccccc1)C(O)=O |
|
| treeView | ||
| subClassOf |