Preferred Name |
triethylamine |
|
Synonyms |
(C2H5)3N (diethylamino)ethane N,N,N-triethylamine TEA Triaethylamin TEN NEt3 N,N-Diethylethanamine Triethylamin Triethylamine N,N-diethylethanamine |
|
Definitions |
A tertiary amine that is ammonia in which each hydrogen atom is substituted by an ethyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_35026 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:605283 CAS:121-44-8 Beilstein:605283 MetaCyc:TRIETHYLAMINE HMDB:HMDB0032539 PMID:24359525 KEGG:C14691 PDBeChem:TEA Gmelin:2455 Wikipedia:Triethylamine |
|
definition |
A tertiary amine that is ammonia in which each hydrogen atom is substituted by an ethyl group. |
|
formula |
C6H15N |
|
has_exact_synonym |
Triethylamine N,N-diethylethanamine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(C2H5)3N (diethylamino)ethane N,N,N-triethylamine TEA Triaethylamin TEN NEt3 N,N-Diethylethanamine Triethylamin |
|
id |
CHEBI:35026 |
|
in_subset | ||
inchi |
InChI=1S/C6H15N/c1-4-7(5-2)6-3/h4-6H2,1-3H3 |
|
inchikey |
ZMANZCXQSJIPKH-UHFFFAOYSA-N |
|
label |
triethylamine |
|
mass |
101.19004 |
|
monoisotopicmass |
101.12045 |
|
notation |
CHEBI:35026 |
|
prefLabel |
triethylamine |
|
smiles |
CCN(CC)CC |
|
treeView | ||
subClassOf |