loading...| Preferred Name |
phenyl salicylate |
|
| Synonyms |
salicylic acid phenyl ester Phenol salicylate 2-Hydroxy-benzoic acid phenyl ester salol 2-Phenoxycarbonylphenol Phenyl-2-hydroxybenzoate phenyl 2-hydroxybenzoate |
|
| Definitions |
A benzoate ester that is the phenyl ester of salicylic acid. Also known as salol, it can be formed by heating salicylic acid with phenol and is used in the manufacture of some polymers, lacquers, adhesives, waxes and polishes. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_34918 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:1650428 PMID:18031889 HMDB:HMDB0032018 PMID:7326927 Beilstein:393969 KEGG:C14163 Drug_Central:3462 PMID:24004914 CAS:118-55-8 Reaxys:393969 Gmelin:219822 Wikipedia:Phenyl_salicylate |
|
| definition |
A benzoate ester that is the phenyl ester of salicylic acid. Also known as salol, it can be formed by heating salicylic acid with phenol and is used in the manufacture of some polymers, lacquers, adhesives, waxes and polishes. |
|
| formula |
C13H10O3 |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
phenyl 2-hydroxybenzoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
salicylic acid phenyl ester Phenol salicylate 2-Hydroxy-benzoic acid phenyl ester salol 2-Phenoxycarbonylphenol Phenyl-2-hydroxybenzoate |
|
| id |
CHEBI:34918 |
|
| in_subset | ||
| inchi |
InChI=1S/C13H10O3/c14-12-9-5-4-8-11(12)13(15)16-10-6-2-1-3-7-10/h1-9,14H |
|
| inchikey |
ZQBAKBUEJOMQEX-UHFFFAOYSA-N |
|
| label |
phenyl salicylate |
|
| mass |
214.21670 |
|
| monoisotopicmass |
214.06299 |
|
| notation |
CHEBI:34918 |
|
| prefLabel |
phenyl salicylate |
|
| smiles |
Oc1ccccc1C(=O)Oc1ccccc1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_26596 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26596 |