loading...| Preferred Name |
2-hydroxyethyl methacrylate |
|
| Synonyms |
2-hydroxyethyl methacrylate 2-Hydroxyethyl methacrylate Hydroxyethyl methacrylate 2-(Methacryloyloxy)ethanol Glycol monomethacrylate Ethylene glycol methacrylate (hydroxyethyl)methacrylate Ethylene glycol monomethacrylate HEMA 2-Hydroxyethylmethacrylate 2-Hydroxyethyl 2-methylacrylate Glycol methacrylate beta-Hydroxyethyl methacrylate 1,2-Ethanediol mono(2-methyl)-2-propenoate |
|
| Definitions |
An enoate ester that is the monomethacryloyl derivative of ethylene glycol. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_34288 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:23370864 PMID:23360228 PMID:23399173 Reaxys:1071583 PMID:23611114 Gmelin:936557 PMID:23275084 PMID:10444249 PMID:15186380 PMID:23670604 PMID:23157270 PMID:11714252 Wikipedia:(Hydroxyethyl)methacrylate PMID:22886489 PMID:23673616 PMID:23305206 KEGG:C14530 PMID:22889382 Beilstein:1071583 PMID:23466546 PMID:23516576 PMID:23587005 PMID:23182953 CAS:868-77-9 PMID:23137186 |
|
| definition |
An enoate ester that is the monomethacryloyl derivative of ethylene glycol. |
|
| formula |
C6H10O3 |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:53441 |
|
| has_exact_synonym |
2-hydroxyethyl methacrylate 2-Hydroxyethyl methacrylate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
Hydroxyethyl methacrylate 2-(Methacryloyloxy)ethanol Glycol monomethacrylate Ethylene glycol methacrylate (hydroxyethyl)methacrylate Ethylene glycol monomethacrylate HEMA 2-Hydroxyethylmethacrylate 2-Hydroxyethyl 2-methylacrylate Glycol methacrylate beta-Hydroxyethyl methacrylate 1,2-Ethanediol mono(2-methyl)-2-propenoate |
|
| id |
CHEBI:34288 |
|
| in_subset | ||
| inchi |
InChI=1S/C6H10O3/c1-5(2)6(8)9-4-3-7/h7H,1,3-4H2,2H3 |
|
| inchikey |
WOBHKFSMXKNTIM-UHFFFAOYSA-N |
|
| label |
2-hydroxyethyl methacrylate |
|
| mass |
130.14180 |
|
| monoisotopicmass |
130.06299 |
|
| notation |
CHEBI:34288 |
|
| prefLabel |
2-hydroxyethyl methacrylate |
|
| smiles |
CC(=C)C(=O)OCCO |
|
| treeView | ||
| subClassOf |