Preferred Name |
sucralose |
|
Synonyms |
1,6-dichloro-1,6-dideoxy-beta-D-fructofuranosyl 4-chloro-4-deoxy-alpha-D-galactopyranoside Trichlorosucrose |
|
Definitions |
A disaccharide derivative consisting of 4-chloro-4-deoxy-alpha-D-galactopyranose and 1,6-dichloro-1,6-dideoxy-beta-D-fructofuranose units linked by a glycosidic bond. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_32159 |
|
charge |
0 |
|
database_cross_reference |
Reaxys:3654410 KEGG:C12285 CAS:56038-13-2 PMID:24687789 Wikipedia:Sucralose PMID:25236212 HMDB:HMDB0031554 |
|
definition |
A disaccharide derivative consisting of 4-chloro-4-deoxy-alpha-D-galactopyranose and 1,6-dichloro-1,6-dideoxy-beta-D-fructofuranose units linked by a glycosidic bond. |
|
formula |
C12H19Cl3O8 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35703 |
|
has_exact_synonym |
1,6-dichloro-1,6-dideoxy-beta-D-fructofuranosyl 4-chloro-4-deoxy-alpha-D-galactopyranoside |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Trichlorosucrose |
|
id |
CHEBI:32159 |
|
in_subset | ||
inchi |
InChI=1S/C12H19Cl3O8/c13-1-4-7(17)10(20)12(3-14,22-4)23-11-9(19)8(18)6(15)5(2-16)21-11/h4-11,16-20H,1-3H2/t4-,5-,6+,7-,8+,9-,10+,11-,12+/m1/s1 |
|
inchikey |
BAQAVOSOZGMPRM-QBMZZYIRSA-N |
|
label |
sucralose |
|
mass |
397.63300 |
|
monoisotopicmass |
396.01455 |
|
notation |
CHEBI:32159 |
|
prefLabel |
sucralose |
|
smiles |
OC[C@H]1O[C@H](O[C@]2(CCl)O[C@H](CCl)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1Cl |
|
treeView | ||
subClassOf |