Preferred Name |
methyl salicylate |
|
Synonyms |
Teaberry oil 2-(Methoxycarbonyl)phenol Betula oil Oil of wintergreen Sweet birch oil 2-Carbomethoxyphenol Gaultheria oil Natural wintergreen oil Methyl o-hydroxybenzoate Methyl 2-hydroxybenzoate Spicewood Oil 2-Hydroxybenzoic acid methyl ester methyl salicylate |
|
Definitions |
A benzoate ester that is the methyl ester of salicylic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_31832 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D01087 PMID:21609308 PMID:21404848 PMID:21327960 Reaxys:971516 KNApSAcK:C00030767 PMID:21249432 PMID:21936953 PMID:21790190 Wikipedia:Methyl_salicylate KEGG:C12305 PMID:21287406 CAS:119-36-8 Drug_Central:4245 |
|
definition |
A benzoate ester that is the methyl ester of salicylic acid. |
|
formula |
C8H8O3 |
|
has functional parent | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_35617 |
|
has_exact_synonym |
methyl salicylate |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Teaberry oil 2-(Methoxycarbonyl)phenol Betula oil Oil of wintergreen Sweet birch oil 2-Carbomethoxyphenol Gaultheria oil Natural wintergreen oil Methyl o-hydroxybenzoate Methyl 2-hydroxybenzoate Spicewood Oil 2-Hydroxybenzoic acid methyl ester |
|
id |
CHEBI:31832 |
|
in_subset | ||
inchi |
InChI=1S/C8H8O3/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5,9H,1H3 |
|
inchikey |
OSWPMRLSEDHDFF-UHFFFAOYSA-N |
|
label |
methyl salicylate |
|
mass |
152.14730 |
|
monoisotopicmass |
152.04734 |
|
notation |
CHEBI:31832 |
|
prefLabel |
methyl salicylate |
|
smiles |
COC(=O)c1ccccc1O |
|
treeView |
http://purl.obolibrary.org/obo/CHEBI_26596 |
|
subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26596 |