loading...| Preferred Name |
carbinoxamine maleate |
|
| Synonyms |
2-[(4-chlorophenyl)(pyridin-2-yl)methoxy]-N,N-dimethylethanamine (2Z)-but-2-enedioate p-carbinoxamine maleate 2-[(4-chlorophenyl)(pyridin-2-yl)methoxy]-N,N-dimethylethanamine maleate paracarbinoxamine maleate 2-(p-chloro-alpha-(2-(dimethylamino)ethoxy)benzyl)pyridine maleate |
|
| Definitions |
The maleic acid salt of carbinoxamine. An ethanolamine-type antihistamine, used for treating hay fever, as well as mild cases of Parkinson's disease. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_31353 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG:D01336 CAS:3505-38-2 DrugBank:DB00748 Beilstein:6557352 |
|
| definition |
The maleic acid salt of carbinoxamine. An ethanolamine-type antihistamine, used for treating hay fever, as well as mild cases of Parkinson's disease. |
|
| formula |
C20H23ClN2O5 |
|
| has part | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_37955 http://purl.obolibrary.org/obo/CHEBI_48876 |
|
| has_exact_synonym |
2-[(4-chlorophenyl)(pyridin-2-yl)methoxy]-N,N-dimethylethanamine (2Z)-but-2-enedioate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
p-carbinoxamine maleate 2-[(4-chlorophenyl)(pyridin-2-yl)methoxy]-N,N-dimethylethanamine maleate paracarbinoxamine maleate 2-(p-chloro-alpha-(2-(dimethylamino)ethoxy)benzyl)pyridine maleate |
|
| id |
CHEBI:31353 |
|
| in_subset | ||
| inchi |
InChI=1S/C16H19ClN2O.C4H4O4/c1-19(2)11-12-20-16(15-5-3-4-10-18-15)13-6-8-14(17)9-7-13;5-3(6)1-2-4(7)8/h3-10,16H,11-12H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
|
| inchikey |
GVNWHCVWDRNXAZ-BTJKTKAUSA-N |
|
| label |
carbinoxamine maleate |
|
| mass |
406.86000 |
|
| monoisotopicmass |
406.12955 |
|
| notation |
CHEBI:31353 |
|
| prefLabel |
carbinoxamine maleate |
|
| smiles |
OC(=O)\C=C/C(O)=O.CN(C)CCOC(c1ccc(Cl)cc1)c1ccccn1 |
|
| treeView | ||
| subClassOf |