Preferred Name |
desloratadine |
|
Synonyms |
DESLORATADINE 8-chloro-11-(piperidin-4-ylidene)-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridine descarboethoxyloratadine 8-chloro-6,11-dihydro-11-(4-piperidinylidene)-5H-benzo(5,6)cyclohepta(1,2-b)pyridine desloratadine 8-Chloro-11-piperidin-4-ylidene-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridine |
|
Definitions |
Loratadine in which the ethoxycarbonyl group attached to the piperidine ring is replaced by hydrogen. The major metabolite of loratidine, desloratadine is an antihistamine which is used for the symptomatic relief of allergic conditions including rhinitis and chronic urticaria. It does not readily enter the central nervous system, so does not cause drowsiness. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_291342 |
|
charge |
0 |
|
database_cross_reference |
CAS:100643-71-8 PMID:11844681 LINCS:LSM-5887 Wikipedia:Desloratadine Patent:EP208855 KEGG:D03693 Beilstein:4263164 DrugBank:DB00967 Patent:US4659716 PMID:9934454 PMID:15482930 Drug_Central:814 |
|
definition |
Loratadine in which the ethoxycarbonyl group attached to the piperidine ring is replaced by hydrogen. The major metabolite of loratidine, desloratadine is an antihistamine which is used for the symptomatic relief of allergic conditions including rhinitis and chronic urticaria. It does not readily enter the central nervous system, so does not cause drowsiness. |
|
formula |
C19H19ClN2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_37955 http://purl.obolibrary.org/obo/CHEBI_48873 |
|
has_exact_synonym |
DESLORATADINE 8-chloro-11-(piperidin-4-ylidene)-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
descarboethoxyloratadine 8-chloro-6,11-dihydro-11-(4-piperidinylidene)-5H-benzo(5,6)cyclohepta(1,2-b)pyridine desloratadine 8-Chloro-11-piperidin-4-ylidene-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridine |
|
id |
CHEBI:291342 |
|
in_subset | ||
inchi |
InChI=1S/C19H19ClN2/c20-16-5-6-17-15(12-16)4-3-14-2-1-9-22-19(14)18(17)13-7-10-21-11-8-13/h1-2,5-6,9,12,21H,3-4,7-8,10-11H2 |
|
inchikey |
JAUOIFJMECXRGI-UHFFFAOYSA-N |
|
label |
desloratadine |
|
mass |
310.82100 |
|
monoisotopicmass |
310.12368 |
|
notation |
CHEBI:291342 |
|
prefLabel |
desloratadine |
|
smiles |
Clc1ccc2c(CCc3cccnc3C2=C2CCNCC2)c1 |
|
treeView | ||
subClassOf |