Preferred Name |
pentostatin |
|
Synonyms |
(8R)-3-(2-deoxy-beta-D-erythro-pentofuranosyl)-3,6,7,8-tetrahydroimidazo[4,5-d][1,3]diazepin-8-ol PD-ADI PD-81565 YK-176 CI 825 co-vidarabine pentostatin PD81565 pentostatina PD 81565 pentostatinum CI825 pentostatine deoxycoformycin CI-825 2'-deoxycoformycin Nipent |
|
Definitions |
A member of the class of coformycins that is coformycin in which the hydroxy group at position 2' is replaced with a hydrogen. It is a drug used for the treatment of hairy cell leukaemia. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_27834 |
|
charge |
0 |
|
database_cross_reference |
PMID:14748654 KEGG:D00155 PDBeChem:DCF Patent:US20040181052 PMID:33437844 PMID:9622483 PMID:36115868 PMID:34851227 PMID:28057947 Drug_Central:2098 PMID:31336367 KEGG:C02267 PMID:29032276 PMID:23361035 CAS:53910-25-1 PMID:16321875 PMID:30820940 PMID:18602399 DrugBank:DB00552 PMID:31566032 PMID:35933011 PMID:31643500 PMID:34563676 PMID:30454654 PMID:33476709 PMID:30825499 PMID:34227372 HMDB:HMDB0014692 PMID:29051060 PMID:31576294 PMID:34984865 PMID:10877055 PMID:32539314 Wikipedia:Pentostatin PMID:29056419 PMID:29269797 PMID:29196889 PMID:29460654 |
|
definition |
A member of the class of coformycins that is coformycin in which the hydroxy group at position 2' is replaced with a hydrogen. It is a drug used for the treatment of hairy cell leukaemia. |
|
formula |
C11H16N4O4 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_35610 http://purl.obolibrary.org/obo/CHEBI_35221 http://purl.obolibrary.org/obo/CHEBI_76956 |
|
has_alternative_id |
CHEBI:23617 CHEBI:4406 CHEBI:41829 |
|
has_exact_synonym |
(8R)-3-(2-deoxy-beta-D-erythro-pentofuranosyl)-3,6,7,8-tetrahydroimidazo[4,5-d][1,3]diazepin-8-ol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
PD-ADI PD-81565 YK-176 CI 825 co-vidarabine pentostatin PD81565 pentostatina PD 81565 pentostatinum CI825 pentostatine deoxycoformycin CI-825 2'-deoxycoformycin Nipent |
|
id |
CHEBI:27834 |
|
in_subset | ||
inchi |
InChI=1S/C11H16N4O4/c16-3-8-6(17)1-9(19-8)15-5-14-10-7(18)2-12-4-13-11(10)15/h4-9,16-18H,1-3H2,(H,12,13)/t6-,7+,8+,9+/m0/s1 |
|
inchikey |
FPVKHBSQESCIEP-JQCXWYLXSA-N |
|
is conjugate base of | ||
label |
pentostatin |
|
mass |
268.273 |
|
monoisotopicmass |
268.11716 |
|
notation |
CHEBI:27834 |
|
prefLabel |
pentostatin |
|
smiles |
OC[C@H]1O[C@H](C[C@@H]1O)N1C=NC2=C1N=CNC[C@H]2O |
|
treeView | ||
subClassOf |