loading...| Preferred Name |
alosetron |
|
| Synonyms |
alosetron 2,3,4,5-Tetrahydro-5-methyl-2-((5-methyl-1H-imidazol-4-yl)methyl)-1H-pyrido(4,3-b)indol-1-one 5-methyl-2-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-1-one |
|
| Definitions |
A pyrido[4,3-b]indole compound having a 5-methyl-1H-imidazol-4-ylmethyl group at the 2-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_253342 |
|
| charge |
0 |
|
| database_cross_reference |
DrugBank:DB00969 KEGG:D07129 CAS:122852-42-0 Wikipedia:Alosetron LINCS:LSM-5576 Drug_Central:129 Patent:EP306323 Beilstein:7140558 Patent:US5360800 |
|
| definition |
A pyrido[4,3-b]indole compound having a 5-methyl-1H-imidazol-4-ylmethyl group at the 2-position. |
|
| formula |
C17H18N4O |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_55324 |
|
| has_exact_synonym |
5-methyl-2-[(5-methyl-1H-imidazol-4-yl)methyl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-1-one |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
alosetron 2,3,4,5-Tetrahydro-5-methyl-2-((5-methyl-1H-imidazol-4-yl)methyl)-1H-pyrido(4,3-b)indol-1-one |
|
| id |
CHEBI:253342 |
|
| in_subset | ||
| inchi |
InChI=1S/C17H18N4O/c1-11-13(19-10-18-11)9-21-8-7-15-16(17(21)22)12-5-3-4-6-14(12)20(15)2/h3-6,10H,7-9H2,1-2H3,(H,18,19) |
|
| inchikey |
JSWZEAMFRNKZNL-UHFFFAOYSA-N |
|
| label |
alosetron |
|
| mass |
294.35100 |
|
| monoisotopicmass |
294.14806 |
|
| notation |
CHEBI:253342 |
|
| prefLabel |
alosetron |
|
| smiles |
Cc1[nH]cnc1CN1CCc2c(C1=O)c1ccccc1n2C |
|
| treeView | ||
| subClassOf |