loading...| Preferred Name |
cinchocaine |
|
| Synonyms |
2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide CINCHOCAINE cinchocainum 2-butoxy-N-[2-(diethylamino)ethyl]-4-quinolinecarboxamide 2-butoxy-N-(beta-diethylaminoethyl)cinchoninamide cincocainio 2-butoxy-N-(alpha-diethylaminoethyl)cinchoninamide 2-butoxyquinoline-4-carboxylic acid diethylaminoethylamide alpha-butyloxycinchonic acid-gamma-diethylethylenediamine alpha-butyloxycinchoninic acid diethylethylenediamide 2-butoxy-N-(2-(diethylamino)ethyl)cinchoninamide N-(2-(diethylamino)ethyl)-2-butoxycinchoninamide Dibucaine dibucaine base 2-Butoxy-quinoline-4-carboxylic acid (2-diethylamino-ethyl)-amide cinchocaine DIBUCAINE 2-N-butoxy-N-(2-diethylaminoethyl)cinchoninamide dibucaine |
|
| Definitions |
A monocarboxylic acid amide that is the 2-(diethylamino)ethyl amide of 2-butoxyquinoline-4-carboxylic acid. One of the most potent and toxic of the long-acting local anesthetics, its parenteral use was restricted to spinal anesthesia. It is now generally only used (usually as the hydrochloride) in creams and ointments and in suppositories for temporary relief of pain and itching associated with skin and anorectal conditions. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_247956 |
|
| charge |
0 |
|
| database_cross_reference |
HMDB:HMDB0014668 Drug_Central:859 Reaxys:275489 Beilstein:275489 KEGG:C07879 PMID:23953476 CAS:85-79-0 LINCS:LSM-6018 KEGG:D00733 PMID:2873227 Wikipedia:Dibucaine DrugBank:DB00527 Patent:US1825623 |
|
| definition |
A monocarboxylic acid amide that is the 2-(diethylamino)ethyl amide of 2-butoxyquinoline-4-carboxylic acid. One of the most potent and toxic of the long-acting local anesthetics, its parenteral use was restricted to spinal anesthesia. It is now generally only used (usually as the hydrochloride) in creams and ointments and in suppositories for temporary relief of pain and itching associated with skin and anorectal conditions. |
|
| formula |
C20H29N3O2 |
|
| has role | ||
| has_alternative_id |
CHEBI:4500 |
|
| has_exact_synonym |
2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide CINCHOCAINE |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
cinchocainum 2-butoxy-N-[2-(diethylamino)ethyl]-4-quinolinecarboxamide 2-butoxy-N-(beta-diethylaminoethyl)cinchoninamide cincocainio 2-butoxy-N-(alpha-diethylaminoethyl)cinchoninamide 2-butoxyquinoline-4-carboxylic acid diethylaminoethylamide alpha-butyloxycinchonic acid-gamma-diethylethylenediamine alpha-butyloxycinchoninic acid diethylethylenediamide 2-butoxy-N-(2-(diethylamino)ethyl)cinchoninamide N-(2-(diethylamino)ethyl)-2-butoxycinchoninamide Dibucaine dibucaine base 2-Butoxy-quinoline-4-carboxylic acid (2-diethylamino-ethyl)-amide cinchocaine DIBUCAINE 2-N-butoxy-N-(2-diethylaminoethyl)cinchoninamide dibucaine |
|
| id |
CHEBI:247956 |
|
| in_subset | ||
| inchi |
InChI=1S/C20H29N3O2/c1-4-7-14-25-19-15-17(16-10-8-9-11-18(16)22-19)20(24)21-12-13-23(5-2)6-3/h8-11,15H,4-7,12-14H2,1-3H3,(H,21,24) |
|
| inchikey |
PUFQVTATUTYEAL-UHFFFAOYSA-N |
|
| label |
cinchocaine |
|
| mass |
343.46320 |
|
| monoisotopicmass |
343.22598 |
|
| notation |
CHEBI:247956 |
|
| prefLabel |
cinchocaine |
|
| smiles |
CCCCOc1cc(C(=O)NCCN(CC)CC)c2ccccc2n1 |
|
| treeView |
http://purl.obolibrary.org/obo/CHEBI_35618 |
|
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35618 |