loading...| Preferred Name |
5-azacytidine |
|
| Synonyms |
5-Azacytidine 4-amino-1-beta-D-ribofuranosyl-1,3,5-triazin-2(1H)-one 5-azacytidine azacitidinum azacitidina 4-Amino-1-beta-D-ribofuranosyl-s-triazin-2(1H)-one Azacitidine |
|
| Definitions |
An N-glycosyl-1,3,5-triazine that is 4-amino-1,3,5-triazin-2(1H)-one substituted by a beta-D-ribofuranosyl residue via an N-glycosidic linkage. An antineoplastic agent, it is used in the treatment of myeloid leukaemia. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_2038 |
|
| charge |
0 |
|
| database_cross_reference |
Reaxys:620461 HMDB:HMDB0015063 PMID:28486212 KEGG:D03021 LINCS:LSM-5218 PMID:28415666 PMID:11841042 Patent:US2015038444 PMID:15962522 PMID:17611569 Drug_Central:25 PMID:28131982 CAS:320-67-2 Patent:KR20140069225 Wikipedia:Azacitidine KEGG:C11262 PMID:29438107 DrugBank:DB00928 |
|
| definition |
An N-glycosyl-1,3,5-triazine that is 4-amino-1,3,5-triazin-2(1H)-one substituted by a beta-D-ribofuranosyl residue via an N-glycosidic linkage. An antineoplastic agent, it is used in the treatment of myeloid leukaemia. |
|
| formula |
C8H12N4O5 |
|
| has functional parent | ||
| has role | ||
| has_exact_synonym |
5-Azacytidine 4-amino-1-beta-D-ribofuranosyl-1,3,5-triazin-2(1H)-one 5-azacytidine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
azacitidinum azacitidina 4-Amino-1-beta-D-ribofuranosyl-s-triazin-2(1H)-one Azacitidine |
|
| id |
CHEBI:2038 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H12N4O5/c9-7-10-2-12(8(16)11-7)6-5(15)4(14)3(1-13)17-6/h2-6,13-15H,1H2,(H2,9,11,16)/t3-,4-,5-,6-/m1/s1 |
|
| inchikey |
NMUSYJAQQFHJEW-KVTDHHQDSA-N |
|
| label |
5-azacytidine |
|
| mass |
244.20484 |
|
| monoisotopicmass |
244.08077 |
|
| notation |
CHEBI:2038 |
|
| prefLabel |
5-azacytidine |
|
| smiles |
Nc1ncn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)n1 |
|
| treeView | ||
| subClassOf |