Preferred Name |
isoflavone |
|
Synonyms |
3-phenyl-4H-chromen-4-one Isoflavone Isoflavon 3-phenyl-4H-1-benzopyran-4-one 3-Phenylchromone |
|
Definitions |
A simplest member of the class of isoflavones that is 4H-chromen-4-one in which the hydrogen at position 3 is replaced by a phenyl group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_18220 |
|
charge |
0 |
|
database_cross_reference |
CAS:574-12-9 Beilstein:157731 Gmelin:1224833 Reaxys:157731 LIPID_MAPS_instance:LMPK12050000 KEGG:C00799 |
|
definition |
A simplest member of the class of isoflavones that is 4H-chromen-4-one in which the hydrogen at position 3 is replaced by a phenyl group. |
|
formula |
C15H10O2 |
|
has_alternative_id |
CHEBI:14467 CHEBI:6013 CHEBI:24892 |
|
has_exact_synonym |
3-phenyl-4H-chromen-4-one Isoflavone |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Isoflavon 3-phenyl-4H-1-benzopyran-4-one 3-Phenylchromone |
|
id |
CHEBI:18220 |
|
in_subset | ||
inchi |
InChI=1S/C15H10O2/c16-15-12-8-4-5-9-14(12)17-10-13(15)11-6-2-1-3-7-11/h1-10H |
|
inchikey |
GOMNOOKGLZYEJT-UHFFFAOYSA-N |
|
label |
isoflavone |
|
mass |
222.23870 |
|
monoisotopicmass |
222.06808 |
|
notation |
CHEBI:18220 |
|
prefLabel |
isoflavone |
|
smiles |
O=c1c(coc2ccccc12)-c1ccccc1 |
|
treeView | ||
subClassOf |