loading...| Preferred Name |
2,3-dihydroxybenzoic acid |
|
| Synonyms |
2,3-Dihydroxybenzoic acid 2,3-dihydroxybenzoic acid pyrocatechuic acid 2,3 DHB catechol-3-carboxylic acid 3-hydroxysalicylic acid o-pyrocatechuic acid 2,3-DIHYDROXY-BENZOIC ACID DOBK 2-pyrocatechuic acid |
|
| Definitions |
A dihydroxybenzoic acid that is benzoic acid substituted by hydroxy groups at positions 2 and 3. It occurs naturally in Phyllanthus acidus and in the aquatic fern Salvinia molesta. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18026 |
|
| charge |
0 |
|
| database_cross_reference |
Beilstein:2209117 KEGG:C00196 PMID:24171385 CAS:303-38-8 KNApSAcK:C00002669 PMID:17065237 DrugBank:DB01672 HMDB:HMDB0000397 Wikipedia:2,3-Dihydroxybenzoic_acid PDBeChem:DBH Reaxys:2209117 PMID:3575393 |
|
| definition |
A dihydroxybenzoic acid that is benzoic acid substituted by hydroxy groups at positions 2 and 3. It occurs naturally in Phyllanthus acidus and in the aquatic fern Salvinia molesta. |
|
| formula |
C7H6O4 |
|
| has functional parent | ||
| has role | ||
| has_alternative_id |
CHEBI:885 CHEBI:19320 CHEBI:41901 |
|
| has_exact_synonym |
2,3-Dihydroxybenzoic acid 2,3-dihydroxybenzoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
pyrocatechuic acid 2,3 DHB catechol-3-carboxylic acid 3-hydroxysalicylic acid o-pyrocatechuic acid 2,3-DIHYDROXY-BENZOIC ACID DOBK 2-pyrocatechuic acid |
|
| id |
CHEBI:18026 |
|
| in_subset | ||
| inchi |
InChI=1S/C7H6O4/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,8-9H,(H,10,11) |
|
| inchikey |
GLDQAMYCGOIJDV-UHFFFAOYSA-N |
|
| is conjugate acid of | ||
| label |
2,3-dihydroxybenzoic acid |
|
| mass |
154.12010 |
|
| monoisotopicmass |
154.02661 |
|
| notation |
CHEBI:18026 |
|
| prefLabel |
2,3-dihydroxybenzoic acid |
|
| smiles |
OC(=O)c1cccc(O)c1O |
|
| treeView | ||
| subClassOf |