Preferred Name |
propane-1,2-diol |
|
Synonyms |
Propane-1,2-diol propane-1,2-diol 1,2-Propanediol MeCH(OH)CH2OH HOCH2CH(OH)CH3 methylethylene glycol methyl glycol HOCH2CH(OH)Me 1,2-dihydroxypropane isopropylene glycol 2-hydroxypropanol methylethyl glycol 1,2-Propylenglykol PPD monopropylene glycol Propylene glycol CH3CH(OH)CH2OH alpha-propyleneglycol |
|
Definitions |
The simplest member of the class of propane-1,2-diols, consisting of propane in which a hydrogen at position 1 and a hydrogen at position 2 are substituted by hydroxy groups. A colourless, viscous, hygroscopic, low-melting (-59degreeC) and high-boiling (188degreeC) liquid with low toxicity, it is used as a solvent, emulsifying agent, and antifreeze. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16997 |
|
charge |
0 |
|
database_cross_reference |
KEGG:D00078 PPDB:1304 Reaxys:1340498 KNApSAcK:C00007410 PMID:21616561 PMID:18845115 Drug_Central:4024 KEGG:C00583 PMID:18346395 LINCS:LSM-36856 VSDB:1304 PMID:16078503 HMDB:HMDB0001881 PMID:15665701 Wikipedia:Propylene_glycol DrugBank:DB01839 CAS:57-55-6 |
|
definition |
The simplest member of the class of propane-1,2-diols, consisting of propane in which a hydrogen at position 1 and a hydrogen at position 2 are substituted by hydroxy groups. A colourless, viscous, hygroscopic, low-melting (-59degreeC) and high-boiling (188degreeC) liquid with low toxicity, it is used as a solvent, emulsifying agent, and antifreeze. |
|
formula |
C3H8O2 |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_50904 http://purl.obolibrary.org/obo/CHEBI_75771 |
|
has_alternative_id |
CHEBI:14899 CHEBI:8469 |
|
has_exact_synonym |
Propane-1,2-diol propane-1,2-diol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
1,2-Propanediol MeCH(OH)CH2OH HOCH2CH(OH)CH3 methylethylene glycol methyl glycol HOCH2CH(OH)Me 1,2-dihydroxypropane isopropylene glycol 2-hydroxypropanol methylethyl glycol 1,2-Propylenglykol PPD monopropylene glycol Propylene glycol CH3CH(OH)CH2OH alpha-propyleneglycol |
|
id |
CHEBI:16997 |
|
in_subset | ||
inchi |
InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3 |
|
inchikey |
DNIAPMSPPWPWGF-UHFFFAOYSA-N |
|
label |
propane-1,2-diol |
|
mass |
76.09442 |
|
monoisotopicmass |
76.05243 |
|
notation |
CHEBI:16997 |
|
prefLabel |
propane-1,2-diol |
|
smiles |
CC(O)CO |
|
treeView | ||
subClassOf |