loading...| Preferred Name |
sulbactam sodium |
|
| Synonyms |
sodium (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate 4,4-dioxide sodium 1,1-dioxypenicillanate sulbactam sodium salt CP-458992 sodium sulbactam CP458992 CP 45899-2 CP-45899-2 penicillanic acid 1,1-dioxide sodium salt sodium penicillanate 1,1-dioxide |
|
| Definitions |
The organic sodium salt of sulbactam. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_157785 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:38125170 PMID:34017455 PMID:34734047 PMID:35685727 PMID:37361226 PMID:38077875 PMID:37452667 DrugBank:DBSALT001310 KEGG:D02223 PMID:22041274 CAS:69388-84-7 PMID:35948985 Chemspider:571120 PMID:33302688 PMID:36074406 PMID:24495837 KEGG:C14001 PMID:28099605 |
|
| definition |
The organic sodium salt of sulbactam. |
|
| formula |
C8H10NO5S.Na |
|
| has part | ||
| has_alternative_id |
CHEBI:34986 |
|
| has_exact_synonym |
sodium (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate 4,4-dioxide |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
sodium 1,1-dioxypenicillanate sulbactam sodium salt CP-458992 sodium sulbactam CP458992 CP 45899-2 CP-45899-2 penicillanic acid 1,1-dioxide sodium salt sodium penicillanate 1,1-dioxide |
|
| id |
CHEBI:157785 |
|
| in_subset | ||
| inchi |
InChI=1S/C8H11NO5S.Na/c1-8(2)6(7(11)12)9-4(10)3-5(9)15(8,13)14;/h5-6H,3H2,1-2H3,(H,11,12);/q;+1/p-1/t5-,6+;/m1./s1 |
|
| inchikey |
NKZMPZCWBSWAOX-IBTYICNHSA-M |
|
| label |
sulbactam sodium |
|
| mass |
255.220 |
|
| monoisotopicmass |
255.01774 |
|
| notation |
CHEBI:157785 |
|
| prefLabel |
sulbactam sodium |
|
| smiles |
[Na+].[H][C@@]12CC(=O)N1[C@@H](C([O-])=O)C(C)(C)S2(=O)=O |
|
| treeView | ||
| subClassOf |