Preferred Name |
anisindione |
|
Synonyms |
2-(4-methoxyphenyl)-1H-indene-1,3(2H)-dione anisindiona anisindionum Anisin indandione 2-(4-Methoxyphenyl)indan-1,3-dione 2-(p-Methoxyphenyl)-1,3-indandione 2-(p-Methoxyphenyl)indane-1,3-dione anisindione 2-para-Anisyl-1,3-indandione 2-(4-Methoxyphenyl)-1H-indene-1,3(2H)-dione 2-p-Anisyl-1,3-indandione |
|
Definitions |
A cyclic beta-diketone consisting of indane-1,3-dione having a 4-methoxyphenyl substituent at the 4-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_133809 |
|
charge |
0 |
|
database_cross_reference |
Drug_Central:222 Wikipedia:Anisindione Beilstein:1880681 Patent:US2899358 CAS:117-37-3 KEGG:D07457 DrugBank:DB01125 |
|
definition |
A cyclic beta-diketone consisting of indane-1,3-dione having a 4-methoxyphenyl substituent at the 4-position. |
|
formula |
C16H12O3 |
|
has parent hydride | ||
has role | ||
has_exact_synonym |
2-(4-methoxyphenyl)-1H-indene-1,3(2H)-dione |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
anisindiona anisindionum Anisin indandione 2-(4-Methoxyphenyl)indan-1,3-dione 2-(p-Methoxyphenyl)-1,3-indandione 2-(p-Methoxyphenyl)indane-1,3-dione anisindione 2-para-Anisyl-1,3-indandione 2-(4-Methoxyphenyl)-1H-indene-1,3(2H)-dione 2-p-Anisyl-1,3-indandione |
|
id |
CHEBI:133809 |
|
in_subset | ||
inchi |
InChI=1S/C16H12O3/c1-19-11-8-6-10(7-9-11)14-15(17)12-4-2-3-5-13(12)16(14)18/h2-9,14H,1H3 |
|
inchikey |
XRCFXMGQEVUZFC-UHFFFAOYSA-N |
|
label |
anisindione |
|
mass |
252.26470 |
|
monoisotopicmass |
252.07864 |
|
notation |
CHEBI:133809 |
|
prefLabel |
anisindione |
|
smiles |
COc1ccc(cc1)C1C(=O)c2ccccc2C1=O |
|
treeView | ||
subClassOf |