loading...| Preferred Name |
sodium benzoate |
|
| Synonyms |
sodium benzoate E211 Sodium benzoate Benzoic acid, sodium salt |
|
| Definitions |
An organic sodium salt resulting from the replacement of the proton from the carboxy group of benzoic acid by a sodium ion. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_113455 |
|
| charge |
0 |
|
| database_cross_reference |
Wikipedia:Sodium_benzoate PMID:26989415 PMID:26870932 KEGG:D02277 PMID:26875563 PMID:27000017 PMID:25377186 PMID:26951541 PMID:25582668 PMID:26907495 Reaxys:1100243 PMID:26706697 PMID:26585641 PMID:26749113 CAS:532-32-1 |
|
| definition |
An organic sodium salt resulting from the replacement of the proton from the carboxy group of benzoic acid by a sodium ion. |
|
| formula |
C7H5NaO2 |
|
| has part | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_64996 http://purl.obolibrary.org/obo/CHEBI_65001 http://purl.obolibrary.org/obo/CHEBI_88188 http://purl.obolibrary.org/obo/CHEBI_76967 |
|
| has_exact_synonym |
sodium benzoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
E211 Sodium benzoate Benzoic acid, sodium salt |
|
| id |
CHEBI:113455 |
|
| in_subset | ||
| inchi |
InChI=1S/C7H6O2.Na/c8-7(9)6-4-2-1-3-5-6;/h1-5H,(H,8,9);/q;+1/p-1 |
|
| inchikey |
WXMKPNITSTVMEF-UHFFFAOYSA-M |
|
| label |
sodium benzoate |
|
| mass |
144.103 |
|
| monoisotopicmass |
144.01872 |
|
| notation |
CHEBI:113455 |
|
| prefLabel |
sodium benzoate |
|
| smiles |
[Na+].[O-]C(=O)C1=CC=CC=C1 |
|
| treeView | ||
| subClassOf |